Paspalitrem C
| Internal ID | d4bf3ab6-77ed-4898-827d-653963705230 |
| Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
| IUPAC Name | (1S,4R,5S,16S,19S,23R)-19-hydroxy-4,5,24,24-tetramethyl-12-(3-methylbut-2-enyl)-25,26-dioxa-7-azaheptacyclo[21.2.1.01,20.04,19.05,16.06,14.08,13]hexacosa-6(14),8,10,12,20-pentaen-22-one |
| SMILES (Canonical) | CC(=CCC1=C2C3=C(C4(C(C3)CCC5(C4(CCC67C5=CC(=O)C(O6)C(O7)(C)C)C)O)C)NC2=CC=C1)C |
| SMILES (Isomeric) | CC(=CCC1=C2C3=C([C@]4([C@H](C3)CC[C@@]5([C@@]4(CC[C@]67C5=CC(=O)[C@H](O6)C(O7)(C)C)C)O)C)NC2=CC=C1)C |
| InChI | InChI=1S/C32H39NO4/c1-18(2)10-11-19-8-7-9-22-25(19)21-16-20-12-13-31(35)24-17-23(34)27-28(3,4)37-32(24,36-27)15-14-29(31,5)30(20,6)26(21)33-22/h7-10,17,20,27,33,35H,11-16H2,1-6H3/t20-,27-,29+,30+,31+,32-/m0/s1 |
| InChI Key | MXOIVWLOTRYIQC-TZHHUJIHSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C32H39NO4 |
| Molecular Weight | 501.70 g/mol |
| Exact Mass | 501.28790873 g/mol |
| Topological Polar Surface Area (TPSA) | 71.60 Ų |
| XlogP | 5.10 |
| 4-(3-Methyl-2-butenyl)paspalinine |
| 44ZSF8JL8Y |
| 4H-3,15A-EPOXY-1-BENZOXEPINO(6',7':6,7)INDENO(1,2-B)INDOL-4-ONE, 2,3,5B,6,7,7A,8,13,13B,13C,14,15-DODECAHYDRO-5B-HYDROXY-2,2,13B,13C-TETRAMETHYL-9-(3-METHYL-2-BUTENYL)-, (3R,5BS,7AS,13BS,13CR,15AS)- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.46% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.94% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.32% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.66% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.66% | 97.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.93% | 93.99% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.78% | 95.56% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 92.97% | 83.82% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.67% | 97.25% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.90% | 85.14% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.85% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.90% | 95.89% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 89.83% | 97.05% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 89.06% | 88.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.45% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.11% | 99.23% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.87% | 93.40% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 86.31% | 98.59% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.77% | 94.75% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 85.04% | 94.23% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.79% | 92.62% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.71% | 90.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.69% | 89.00% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 84.61% | 97.50% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 83.83% | 91.38% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.14% | 94.62% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.56% | 94.73% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 82.13% | 97.28% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 81.82% | 94.08% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.31% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 9848881 |
| LOTUS | LTS0014828 |
| wikiData | Q105174422 |