Paspalinine
Internal ID | 5534f475-68cb-4a06-8062-5c6fb443c6e3 |
Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
IUPAC Name | (1S,4R,5S,16S,19S,23R)-19-hydroxy-4,5,24,24-tetramethyl-25,26-dioxa-7-azaheptacyclo[21.2.1.01,20.04,19.05,16.06,14.08,13]hexacosa-6(14),8,10,12,20-pentaen-22-one |
SMILES (Canonical) | CC1(C2C(=O)C=C3C4(CCC5CC6=C(C5(C4(CCC3(O2)O1)C)C)NC7=CC=CC=C67)O)C |
SMILES (Isomeric) | C[C@]12CC[C@]34C(=CC(=O)[C@H](O3)C(O4)(C)C)[C@@]1(CC[C@@H]5[C@@]2(C6=C(C5)C7=CC=CC=C7N6)C)O |
InChI | InChI=1S/C27H31NO4/c1-23(2)22-19(29)14-20-26(30)10-9-15-13-17-16-7-5-6-8-18(16)28-21(17)25(15,4)24(26,3)11-12-27(20,31-22)32-23/h5-8,14-15,22,28,30H,9-13H2,1-4H3/t15-,22-,24+,25+,26+,27-/m0/s1 |
InChI Key | BPTIXFRJAOKMRK-SAMRHTEJSA-N |
Popularity | 6 references in papers |
Molecular Formula | C27H31NO4 |
Molecular Weight | 433.50 g/mol |
Exact Mass | 433.22530847 g/mol |
Topological Polar Surface Area (TPSA) | 71.60 Ų |
XlogP | 3.20 |
63722-91-8 |
D97Q5DS722 |
(1S,4R,5S,16S,19S,23R)-19-hydroxy-4,5,24,24-tetramethyl-25,26-dioxa-7-azaheptacyclo[21.2.1.01,20.04,19.05,16.06,14.08,13]hexacosa-6(14),8,10,12,20-pentaen-22-one |
UNII-D97Q5DS722 |
PASPALININ |
(+)-PASPALININE |
11-HYDROXYPASPALICINE |
CHEBI:138862 |
HY-N10080 |
AKOS040762788 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.26% | 91.11% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.33% | 83.82% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.65% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 95.12% | 98.95% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 94.73% | 94.23% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.65% | 93.99% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.94% | 96.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.77% | 99.23% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.38% | 85.14% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 91.87% | 94.62% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.27% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.47% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.33% | 97.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.28% | 91.49% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 88.09% | 94.08% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 86.65% | 88.56% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.97% | 94.75% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.11% | 95.89% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.00% | 97.25% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 82.69% | 97.05% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.32% | 100.00% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 82.08% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.18% | 94.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 81.06% | 96.61% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Upuna borneensis |
Vatica pauciflora |
Vitis vinifera |
PubChem | 9867531 |
LOTUS | LTS0257557 |
wikiData | Q105179655 |