Paracelsin E
| Internal ID | cd4fd2aa-2860-47e6-89ec-acc2f694bc60 |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | 2-[2-[[2-[2-[[2-[2-[(2-acetamido-2-methylpropanoyl)amino]propanoylamino]-2-methylpropanoyl]amino]propanoylamino]-2-methylpropanoyl]amino]propanoylamino]-N-[1-[[1-[[1-[[2-[[1-[[1-[2-[[1-[[1-[[1-[[5-amino-1-[[5-amino-1-[(1-hydroxy-3-phenylpropan-2-yl)amino]-1,5-dioxopentan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-2-methyl-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-2-methyl-1-oxopropan-2-yl]pentanediamide |
| SMILES (Canonical) | CC(C)CC(C(=O)NC(C)(C)C(=O)NCC(=O)NC(C)(C)C(=O)NC(C)C(=O)N1CCCC1C(=O)NC(C(C)C)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)NC(CCC(=O)N)C(=O)NC(CCC(=O)N)C(=O)NC(CC2=CC=CC=C2)CO)NC(=O)C(C)(C)NC(=O)C(CCC(=O)N)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C |
| SMILES (Isomeric) | CC(C)CC(C(=O)NC(C)(C)C(=O)NCC(=O)NC(C)(C)C(=O)NC(C)C(=O)N1CCCC1C(=O)NC(C(C)C)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)NC(CCC(=O)N)C(=O)NC(CCC(=O)N)C(=O)NC(CC2=CC=CC=C2)CO)NC(=O)C(C)(C)NC(=O)C(CCC(=O)N)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C |
| InChI | InChI=1S/C88H145N23O24/c1-44(2)40-56(101-78(133)86(20,21)107-68(123)55(35-38-60(91)116)98-63(118)46(5)93-76(131)84(16,17)105-65(120)48(7)95-77(132)85(18,19)106-64(119)47(6)94-74(129)82(12,13)103-50(9)113)69(124)108-81(10,11)73(128)92-42-61(117)104-83(14,15)75(130)96-49(8)72(127)111-39-29-32-57(111)70(125)102-62(45(3)4)71(126)109-88(24,25)80(135)110-87(22,23)79(134)100-54(34-37-59(90)115)67(122)99-53(33-36-58(89)114)66(121)97-52(43-112)41-51-30-27-26-28-31-51/h26-28,30-31,44-49,52-57,62,112H,29,32-43H2,1-25H3,(H2,89,114)(H2,90,115)(H2,91,116)(H,92,128)(H,93,131)(H,94,129)(H,95,132)(H,96,130)(H,97,121)(H,98,118)(H,99,122)(H,100,134)(H,101,133)(H,102,125)(H,103,113)(H,104,117)(H,105,120)(H,106,119)(H,107,123)(H,108,124)(H,109,126)(H,110,135) |
| InChI Key | SYIILBPFSYCOFW-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C88H145N23O24 |
| Molecular Weight | 1909.20 g/mol |
| Exact Mass | 1908.08328259 g/mol |
| Topological Polar Surface Area (TPSA) | 723.00 Ų |
| XlogP | -3.70 |
| Atomic LogP (AlogP) | -6.07 |
| H-Bond Acceptor | 24 |
| H-Bond Donor | 23 |
| Rotatable Bonds | 53 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7874 | 78.74% |
| Caco-2 | - | 0.8595 | 85.95% |
| Blood Brain Barrier | - | 0.6500 | 65.00% |
| Human oral bioavailability | - | 0.6286 | 62.86% |
| Subcellular localzation | Lysosomes | 0.5558 | 55.58% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8470 | 84.70% |
| OATP1B3 inhibitior | + | 0.9448 | 94.48% |
| MATE1 inhibitior | - | 0.8812 | 88.12% |
| OCT2 inhibitior | - | 0.9000 | 90.00% |
| BSEP inhibitior | + | 0.9555 | 95.55% |
| P-glycoprotein inhibitior | + | 0.7421 | 74.21% |
| P-glycoprotein substrate | + | 0.8751 | 87.51% |
| CYP3A4 substrate | + | 0.7396 | 73.96% |
| CYP2C9 substrate | - | 0.7891 | 78.91% |
| CYP2D6 substrate | - | 0.8322 | 83.22% |
| CYP3A4 inhibition | + | 0.6383 | 63.83% |
| CYP2C9 inhibition | - | 0.8832 | 88.32% |
| CYP2C19 inhibition | - | 0.6613 | 66.13% |
| CYP2D6 inhibition | - | 0.8527 | 85.27% |
| CYP1A2 inhibition | - | 0.8954 | 89.54% |
| CYP2C8 inhibition | + | 0.6814 | 68.14% |
| CYP inhibitory promiscuity | - | 0.9394 | 93.94% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8100 | 81.00% |
| Carcinogenicity (trinary) | Non-required | 0.6372 | 63.72% |
| Eye corrosion | - | 0.9873 | 98.73% |
| Eye irritation | - | 0.8955 | 89.55% |
| Skin irritation | - | 0.7911 | 79.11% |
| Skin corrosion | - | 0.9038 | 90.38% |
| Ames mutagenesis | - | 0.7200 | 72.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7180 | 71.80% |
| Micronuclear | + | 0.6400 | 64.00% |
| Hepatotoxicity | + | 0.5084 | 50.84% |
| skin sensitisation | - | 0.8805 | 88.05% |
| Respiratory toxicity | + | 0.9000 | 90.00% |
| Reproductive toxicity | + | 0.9000 | 90.00% |
| Mitochondrial toxicity | + | 0.9000 | 90.00% |
| Nephrotoxicity | - | 0.6602 | 66.02% |
| Acute Oral Toxicity (c) | III | 0.6656 | 66.56% |
| Estrogen receptor binding | - | 0.5864 | 58.64% |
| Androgen receptor binding | + | 0.7492 | 74.92% |
| Thyroid receptor binding | + | 0.7852 | 78.52% |
| Glucocorticoid receptor binding | + | 0.8342 | 83.42% |
| Aromatase binding | + | 0.8114 | 81.14% |
| PPAR gamma | + | 0.8024 | 80.24% |
| Honey bee toxicity | - | 0.7421 | 74.21% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | + | 0.5800 | 58.00% |
| Fish aquatic toxicity | - | 0.4018 | 40.18% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.96% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.56% | 96.61% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 99.20% | 98.33% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 97.60% | 93.56% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 97.42% | 95.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.35% | 90.17% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 97.16% | 97.64% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 96.84% | 98.24% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.49% | 96.09% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 95.69% | 100.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 94.73% | 100.00% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 94.41% | 94.45% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 94.31% | 97.14% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 94.22% | 89.63% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.19% | 97.09% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 93.40% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.34% | 91.11% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 92.97% | 82.69% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.89% | 91.19% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 92.42% | 93.33% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 92.29% | 96.03% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.84% | 96.47% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 91.29% | 93.00% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 90.38% | 96.67% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 88.73% | 98.94% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.42% | 95.56% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 88.12% | 97.23% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.08% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.95% | 94.45% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 87.43% | 96.67% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.33% | 95.89% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 87.17% | 97.50% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 86.86% | 88.42% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.45% | 96.00% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 84.89% | 98.10% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 84.79% | 98.05% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 84.49% | 92.80% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 84.44% | 89.33% |
| CHEMBL5028 | O14672 | ADAM10 | 83.71% | 97.50% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 81.71% | 87.16% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 81.33% | 83.14% |
| CHEMBL249 | P25103 | Neurokinin 1 receptor | 81.04% | 99.17% |
| CHEMBL1841 | P06241 | Tyrosine-protein kinase FYN | 80.99% | 81.29% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.80% | 95.83% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.76% | 95.38% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.48% | 100.00% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 80.38% | 83.10% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.32% | 97.25% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 80.16% | 96.28% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139588019 |
| LOTUS | LTS0046384 |
| wikiData | Q104197773 |