Papaveraldine
| Internal ID | a4e29a1c-93a8-4705-bedb-9559479419f2 |
| Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives > Benzylisoquinolines |
| IUPAC Name | (6,7-dimethoxyisoquinolin-1-yl)-(3,4-dimethoxyphenyl)methanone |
| SMILES (Canonical) | COC1=C(C=C(C=C1)C(=O)C2=NC=CC3=CC(=C(C=C32)OC)OC)OC |
| SMILES (Isomeric) | COC1=C(C=C(C=C1)C(=O)C2=NC=CC3=CC(=C(C=C32)OC)OC)OC |
| InChI | InChI=1S/C20H19NO5/c1-23-15-6-5-13(10-16(15)24-2)20(22)19-14-11-18(26-4)17(25-3)9-12(14)7-8-21-19/h5-11H,1-4H3 |
| InChI Key | QJTBIAMBPGGIGI-UHFFFAOYSA-N |
| Popularity | 95 references in papers |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.12632271 g/mol |
| Topological Polar Surface Area (TPSA) | 66.90 Ų |
| XlogP | 3.70 |
| Atomic LogP (AlogP) | 3.50 |
| H-Bond Acceptor | 6 |
| H-Bond Donor | 0 |
| Rotatable Bonds | 6 |
| 522-57-6 |
| Xanthaline |
| Papaveraldin |
| 6,7-Dimethoxy-1-veratroylisoquinoline |
| L8825LX0F5 |
| NSC-94266 |
| DTXSID90200239 |
| 1-((3,4-dimethoxyphenyl)carbonyl)-6,7-dimethoxyisoquinoline |
| 1-[(3,4-dimethoxyphenyl)carbonyl]-6,7-dimethoxyisoquinoline |
| RefChem:928569 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9925 | 99.25% |
| Caco-2 | + | 0.9151 | 91.51% |
| Blood Brain Barrier | - | 0.5250 | 52.50% |
| Human oral bioavailability | + | 0.8143 | 81.43% |
| Subcellular localzation | Mitochondria | 0.5927 | 59.27% |
| OATP2B1 inhibitior | - | 0.8657 | 86.57% |
| OATP1B1 inhibitior | + | 0.9661 | 96.61% |
| OATP1B3 inhibitior | + | 0.9788 | 97.88% |
| MATE1 inhibitior | - | 0.9000 | 90.00% |
| OCT2 inhibitior | - | 0.9750 | 97.50% |
| BSEP inhibitior | + | 0.6875 | 68.75% |
| P-glycoprotein inhibitior | + | 0.7111 | 71.11% |
| P-glycoprotein substrate | - | 0.5843 | 58.43% |
| CYP3A4 substrate | - | 0.5661 | 56.61% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.7304 | 73.04% |
| CYP3A4 inhibition | + | 0.7897 | 78.97% |
| CYP2C9 inhibition | - | 0.9146 | 91.46% |
| CYP2C19 inhibition | + | 0.5231 | 52.31% |
| CYP2D6 inhibition | - | 0.8268 | 82.68% |
| CYP1A2 inhibition | + | 0.9106 | 91.06% |
| CYP2C8 inhibition | + | 0.8874 | 88.74% |
| CYP inhibitory promiscuity | + | 0.7384 | 73.84% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.9610 | 96.10% |
| Carcinogenicity (trinary) | Non-required | 0.6235 | 62.35% |
| Eye corrosion | - | 0.9912 | 99.12% |
| Eye irritation | - | 0.7994 | 79.94% |
| Skin irritation | - | 0.8235 | 82.35% |
| Skin corrosion | - | 0.9833 | 98.33% |
| Ames mutagenesis | + | 0.5600 | 56.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6606 | 66.06% |
| Micronuclear | + | 0.6759 | 67.59% |
| Hepatotoxicity | + | 0.6532 | 65.32% |
| skin sensitisation | - | 0.9563 | 95.63% |
| Respiratory toxicity | - | 0.6444 | 64.44% |
| Reproductive toxicity | + | 0.6333 | 63.33% |
| Mitochondrial toxicity | + | 0.5125 | 51.25% |
| Nephrotoxicity | - | 0.7771 | 77.71% |
| Acute Oral Toxicity (c) | II | 0.4618 | 46.18% |
| Estrogen receptor binding | + | 0.9351 | 93.51% |
| Androgen receptor binding | + | 0.6779 | 67.79% |
| Thyroid receptor binding | + | 0.7995 | 79.95% |
| Glucocorticoid receptor binding | + | 0.8595 | 85.95% |
| Aromatase binding | + | 0.6032 | 60.32% |
| PPAR gamma | + | 0.6640 | 66.40% |
| Honey bee toxicity | - | 0.9561 | 95.61% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | - | 0.5715 | 57.15% |
| Fish aquatic toxicity | - | 0.4891 | 48.91% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1795093 | O14727 | Apoptotic protease-activating factor 1 |
24400 nM |
IC50 |
via CMAUP
|
| CHEMBL2334 | P42574 | Caspase-3 |
8210 nM |
IC50 |
via CMAUP
|
| CHEMBL1287622 | Q9Y468 | Lethal(3)malignant brain tumor-like protein 1 |
39810.7 nM |
Potency |
via CMAUP
|
| CHEMBL1741215 | Q9GZR1 | Sentrin-specific protease 6 |
805 nM 805 nM |
IC50 IC50 |
via Super-PRED
via CMAUP |
| CHEMBL1741213 | Q9BQF6 | Sentrin-specific protease 7 |
1670 nM |
IC50 |
via CMAUP
|
| CHEMBL1741207 | Q96LD8 | Sentrin-specific protease 8 |
2470 nM |
IC50 |
via CMAUP
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2535 | P11166 | Glucose transporter | 94.49% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.31% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.65% | 99.17% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.71% | 94.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.81% | 92.94% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.32% | 90.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.02% | 96.09% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 87.07% | 96.47% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 85.42% | 90.20% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.21% | 96.00% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 83.97% | 96.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.48% | 89.62% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 83.43% | 91.49% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.45% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aloe microstigma |
| Chrozophora plicata |
| Papaver somniferum |
| Vicia faba |
| PubChem | 96932 |
| NPASS | NPC146976 |
| ChEMBL | CHEMBL205040 |
| LOTUS | LTS0037680 |
| wikiData | Q1689762 |