Panduratin
Internal ID | f6d8f8fc-4f77-463a-92cb-619c41308836 |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
IUPAC Name | (2,6-dihydroxy-4-methoxyphenyl)-[3-methyl-2-(3-methylbut-2-enyl)-6-phenylcyclohex-3-en-1-yl]methanone |
SMILES (Canonical) | CC1=CCC(C(C1CC=C(C)C)C(=O)C2=C(C=C(C=C2O)OC)O)C3=CC=CC=C3 |
SMILES (Isomeric) | CC1=CCC(C(C1CC=C(C)C)C(=O)C2=C(C=C(C=C2O)OC)O)C3=CC=CC=C3 |
InChI | InChI=1S/C26H30O4/c1-16(2)10-12-20-17(3)11-13-21(18-8-6-5-7-9-18)24(20)26(29)25-22(27)14-19(30-4)15-23(25)28/h5-11,14-15,20-21,24,27-28H,12-13H2,1-4H3 |
InChI Key | LYDZCXVWCFJAKQ-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C26H30O4 |
Molecular Weight | 406.50 g/mol |
Exact Mass | 406.21440943 g/mol |
Topological Polar Surface Area (TPSA) | 66.80 Ų |
XlogP | 6.00 |
Nicolaioidesin A |
(.+/-.)-Nicolaioidesin A |
LYDZCXVWCFJAKQ-UHFFFAOYSA-N |
XP180835 |
(2,6-Dihydroxy-4-methoxyphenyl)((1R,2R,3R)-4-methyl-3-(3-methylbut-2-en-1-yl)-1,2,3,6-tetrahydro-[1,1'-biphenyl]-2-yl)methanone |
Methanone, (2,6-dihydroxy-4-methoxyphenyl)[(1R,2R,6R)-3-methyl-2-(3-methyl-2-buten-1-yl)-6-phenyl-3-cyclohexen-1-yl]-, rel- |
Methanone, (2,6-dihydroxy-4-methoxyphenyl)[(1R,2R,6R)-3-methyl-2-(3-methyl-2-butenyl)-6-phenyl-3-cyclohexen-1-yl]-, rel- |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.81% | 91.11% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 95.64% | 96.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.60% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.30% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 92.30% | 98.95% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 91.97% | 97.21% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.94% | 99.15% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.42% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.54% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.74% | 97.09% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.55% | 95.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.84% | 90.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.25% | 90.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.10% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.39% | 99.17% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.95% | 91.07% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.22% | 95.89% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 81.58% | 94.08% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.73% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Boesenbergia rotunda |
Renealmia nicolaioides |
PubChem | 91192388 |
LOTUS | LTS0181326 |
wikiData | Q105159242 |