Pancixanthone A
Internal ID | 500aec64-7fa0-4f5b-a5e8-5451a6ddb9e2 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
IUPAC Name | 1,3,5-trihydroxy-4-(2-methylbut-3-en-2-yl)xanthen-9-one |
SMILES (Canonical) | CC(C)(C=C)C1=C(C=C(C2=C1OC3=C(C2=O)C=CC=C3O)O)O |
SMILES (Isomeric) | CC(C)(C=C)C1=C(C=C(C2=C1OC3=C(C2=O)C=CC=C3O)O)O |
InChI | InChI=1S/C18H16O5/c1-4-18(2,3)14-12(21)8-11(20)13-15(22)9-6-5-7-10(19)16(9)23-17(13)14/h4-8,19-21H,1H2,2-3H3 |
InChI Key | PNPYKPQUXNWIPR-UHFFFAOYSA-N |
Popularity | 5 references in papers |
Molecular Formula | C18H16O5 |
Molecular Weight | 312.30 g/mol |
Exact Mass | 312.09977361 g/mol |
Topological Polar Surface Area (TPSA) | 87.00 Ų |
XlogP | 4.40 |
174232-30-5 |
1,3,5-trihydroxy-4-(2-methylbut-3-en-2-yl)xanthen-9-one |
1,3,5-Trihydroxy-4-(2-methylbut-3-en-2-yl)-9H-xanthen-9-one |
starbld0008471 |
HY-N8338 |
AKOS040762161 |
CS-0143287 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.95% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.83% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 96.31% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.39% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 95.31% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.88% | 89.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.22% | 93.99% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 87.61% | 93.65% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.57% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.31% | 99.23% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.00% | 94.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.31% | 94.75% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 81.64% | 83.57% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 80.22% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Calophyllum pauciflorum |
Cratoxylum sumatranum |
Garcinia vieillardii |
PubChem | 10852567 |
LOTUS | LTS0067842 |
wikiData | Q105212109 |