Palytoxin
| Internal ID | 7cc37b2b-c8d3-40c4-849b-f65fc6b6cbb6 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
| IUPAC Name | (E,2S,3R,5R,8R,9S)-10-[(2R,3R,4R,5S,6R)-6-[(1S,2R,3S,4S,5R,11S)-12-[(1R,3S,5S,7R)-5-[(8S)-9-[(2R,3R,4R,5R,6S)-6-[(E,2S,3S,6S,9R,10R)-10-[(2S,4R,5S,6R)-6-[(2R,3R)-4-[(2R,3S,4R,5R,6S)-6-[(2S,3Z,5E,8R,9S,10R,12Z,17S,18R,19R,20R)-21-[(2R,3R,4R,5S,6R)-6-[(Z,3R,4R)-5-[(1S,3R,5R,7R)-7-[2-[(2R,3R,5S)-5-(aminomethyl)-3-hydroxyoxolan-2-yl]ethyl]-2,6-dioxabicyclo[3.2.1]octan-3-yl]-3,4-dihydroxypent-1-enyl]-3,4,5-trihydroxyoxan-2-yl]-2,8,9,10,17,18,19-heptahydroxy-20-methyl-14-methylidenehenicosa-3,5,12-trienyl]-3,4,5-trihydroxyoxan-2-yl]-2,3-dihydroxybutyl]-4,5-dihydroxyoxan-2-yl]-2,6,9,10-tetrahydroxy-3-methyldec-4-enyl]-3,4,5,6-tetrahydroxyoxan-2-yl]-8-hydroxynonyl]-1,3-dimethyl-6,8-dioxabicyclo[3.2.1]octan-7-yl]-1,2,3,4,5-pentahydroxy-11-methyldodecyl]-3,4,5-trihydroxyoxan-2-yl]-2,5,8,9-tetrahydroxy-N-[(E)-3-(3-hydroxypropylamino)-3-oxoprop-1-enyl]-3,7-dimethyldec-6-enamide |
| SMILES (Canonical) | CC1CC2(C(OC(C1)(O2)CCCCCCCC(CC3C(C(C(C(O3)(CC(C(C)C=CC(CCC(C(C4CC(C(C(O4)CC(C(CC5C(C(C(C(O5)CC(C=CC=CCC(C(C(CC=CC(=C)CCC(C(C(C(C)CC6C(C(C(C(O6)C=CC(C(CC7CC8CC(O7)C(O8)CCC9C(CC(O9)CN)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)CC(C)CCCCCC(C(C(C(C(C1C(C(C(C(O1)CC(C(C(=CC(CC(C)C(C(=O)NC=CC(=O)NCCCO)O)O)C)O)O)O)O)O)O)O)O)O)O)C |
| SMILES (Isomeric) | C[C@H]1C[C@@]2([C@H](O[C@](C1)(O2)CCCCCCC[C@@H](C[C@@H]3[C@@H]([C@H]([C@H]([C@@](O3)(C[C@@H]([C@@H](C)/C=C/[C@H](CC[C@H]([C@H]([C@@H]4C[C@H]([C@@H]([C@H](O4)C[C@H]([C@@H](C[C@@H]5[C@H]([C@@H]([C@H]([C@@H](O5)C[C@@H](/C=C\C=C\C[C@H]([C@@H]([C@@H](C/C=C\C(=C)CC[C@@H]([C@H]([C@@H]([C@H](C)C[C@@H]6[C@@H]([C@H]([C@@H]([C@H](O6)/C=C\[C@H]([C@@H](C[C@@H]7C[C@@H]8C[C@H](O7)[C@H](O8)CC[C@@H]9[C@@H](C[C@H](O9)CN)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)C[C@@H](C)CCCCC[C@H]([C@@H]([C@@H]([C@H]([C@@H]([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)C[C@@H]([C@@H](/C(=C/[C@@H](C[C@@H](C)[C@@H](C(=O)N/C=C/C(=O)NCCCO)O)O)/C)O)O)O)O)O)O)O)O)O)O)C |
| InChI | InChI=1S/C129H223N3O54/c1-62(29-33-81(143)108(158)103(153)68(7)47-93-111(161)117(167)110(160)91(180-93)36-35-76(138)82(144)51-73-50-74-53-92(178-73)90(177-74)38-37-89-85(147)52-75(61-130)179-89)23-20-28-78(140)105(155)77(139)26-18-13-16-25-70(135)48-94-112(162)118(168)113(163)97(181-94)55-84(146)83(145)54-95-107(157)87(149)57-96(182-95)106(156)80(142)34-32-69(134)31-30-65(4)88(150)60-129(176)125(174)123(173)115(165)99(184-129)49-71(136)24-15-10-9-11-19-40-128-59-64(3)58-127(8,186-128)100(185-128)44-63(2)22-14-12-17-27-79(141)109(159)116(166)120(170)122(172)124-121(171)119(169)114(164)98(183-124)56-86(148)102(152)66(5)45-72(137)46-67(6)104(154)126(175)132-42-39-101(151)131-41-21-43-133/h13,16,18,20,23,25,30-31,35-36,39,42,45,63-65,67-100,102-125,133-150,152-174,176H,1,9-12,14-15,17,19,21-22,24,26-29,32-34,37-38,40-41,43-44,46-61,130H2,2-8H3,(H,131,151)(H,132,175)/b18-13+,23-20-,25-16-,31-30+,36-35-,42-39+,66-45+/t63-,64-,65-,67+,68+,69+,70+,71-,72-,73-,74+,75-,76+,77+,78+,79+,80+,81-,82+,83+,84+,85+,86-,87+,88-,89+,90+,91+,92-,93+,94-,95+,96-,97+,98+,99+,100+,102+,103+,104-,105-,106+,107-,108+,109-,110+,111-,112-,113+,114-,115-,116-,117-,118+,119+,120+,121-,122-,123+,124-,125+,127+,128-,129-/m0/s1 |
| InChI Key | CWODDUGJZSCNGB-HQNRRURTSA-N |
| Popularity | 383 references in papers |
| Molecular Formula | C129H223N3O54 |
| Molecular Weight | 2680.10 g/mol |
| Exact Mass | 2679.4829484 g/mol |
| Topological Polar Surface Area (TPSA) | 1030.00 Ų |
| XlogP | -6.60 |
| Atomic LogP (AlogP) | -8.64 |
| H-Bond Acceptor | 55 |
| H-Bond Donor | 45 |
| Rotatable Bonds | 80 |
| Palytoxin [MI] |
| UNII-OQ17NC0MOV |
| OQ17NC0MOV |
| 11077-03-5 |
| 77734-91-9 |
| Palytoxin from palythoa toxica or palythoa tuberculosa |
| Palytoxin (C43-C47-hemiacetal) |
| Palytoxin (acetal) |
| HSDB 8132 |
| PLTX |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.7164 | 71.64% |
| Caco-2 | - | 0.8584 | 85.84% |
| Blood Brain Barrier | - | 0.8250 | 82.50% |
| Human oral bioavailability | - | 0.6714 | 67.14% |
| Subcellular localzation | Mitochondria | 0.5749 | 57.49% |
| OATP2B1 inhibitior | - | 0.8636 | 86.36% |
| OATP1B1 inhibitior | + | 0.7948 | 79.48% |
| OATP1B3 inhibitior | + | 0.9363 | 93.63% |
| MATE1 inhibitior | - | 0.9012 | 90.12% |
| OCT2 inhibitior | - | 0.9000 | 90.00% |
| BSEP inhibitior | + | 0.9525 | 95.25% |
| P-glycoprotein inhibitior | + | 0.7416 | 74.16% |
| P-glycoprotein substrate | + | 0.8668 | 86.68% |
| CYP3A4 substrate | + | 0.7670 | 76.70% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8639 | 86.39% |
| CYP3A4 inhibition | - | 0.9257 | 92.57% |
| CYP2C9 inhibition | - | 0.8665 | 86.65% |
| CYP2C19 inhibition | - | 0.8465 | 84.65% |
| CYP2D6 inhibition | - | 0.9186 | 91.86% |
| CYP1A2 inhibition | - | 0.8708 | 87.08% |
| CYP2C8 inhibition | + | 0.8824 | 88.24% |
| CYP inhibitory promiscuity | - | 0.9377 | 93.77% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.9600 | 96.00% |
| Carcinogenicity (trinary) | Non-required | 0.4815 | 48.15% |
| Eye corrosion | - | 0.9843 | 98.43% |
| Eye irritation | - | 0.8961 | 89.61% |
| Skin irritation | - | 0.7224 | 72.24% |
| Skin corrosion | - | 0.9172 | 91.72% |
| Ames mutagenesis | - | 0.5315 | 53.15% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7535 | 75.35% |
| Micronuclear | + | 0.6900 | 69.00% |
| Hepatotoxicity | - | 0.5041 | 50.41% |
| skin sensitisation | - | 0.8313 | 83.13% |
| Respiratory toxicity | + | 0.7444 | 74.44% |
| Reproductive toxicity | + | 0.9667 | 96.67% |
| Mitochondrial toxicity | + | 0.9625 | 96.25% |
| Nephrotoxicity | + | 0.4792 | 47.92% |
| Acute Oral Toxicity (c) | III | 0.5955 | 59.55% |
| Estrogen receptor binding | + | 0.7136 | 71.36% |
| Androgen receptor binding | + | 0.7722 | 77.22% |
| Thyroid receptor binding | + | 0.7171 | 71.71% |
| Glucocorticoid receptor binding | + | 0.8066 | 80.66% |
| Aromatase binding | + | 0.6887 | 68.87% |
| PPAR gamma | + | 0.8229 | 82.29% |
| Honey bee toxicity | - | 0.5824 | 58.24% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | - | 0.6300 | 63.00% |
| Fish aquatic toxicity | + | 0.8797 | 87.97% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.86% | 91.11% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 99.46% | 95.92% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.20% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.40% | 96.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 97.35% | 94.75% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.99% | 90.17% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.37% | 97.09% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 96.34% | 96.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.30% | 99.17% |
| CHEMBL204 | P00734 | Thrombin | 96.29% | 96.01% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 96.21% | 100.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 96.19% | 97.21% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 95.79% | 94.73% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 95.07% | 95.93% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 94.85% | 100.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 94.71% | 97.29% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 94.60% | 89.67% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 93.03% | 80.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.00% | 93.56% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 92.91% | 98.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.84% | 89.00% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 92.49% | 91.24% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 91.99% | 98.05% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 91.82% | 93.10% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 90.98% | 92.32% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 90.96% | 90.08% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.85% | 97.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.55% | 86.33% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.27% | 95.89% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.15% | 96.47% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 89.74% | 96.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.73% | 91.19% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.53% | 96.38% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 87.83% | 96.90% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.73% | 96.00% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 87.66% | 93.18% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.51% | 91.07% |
| CHEMBL236 | P41143 | Delta opioid receptor | 87.21% | 99.35% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 86.83% | 96.33% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 86.42% | 89.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.19% | 95.89% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.05% | 95.50% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 85.79% | 88.56% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.64% | 100.00% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 85.48% | 95.71% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.48% | 95.50% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.40% | 85.14% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 85.27% | 95.00% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 85.14% | 94.45% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 84.65% | 89.44% |
| CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 84.17% | 88.00% |
| CHEMBL4246 | P42680 | Tyrosine-protein kinase TEC | 83.63% | 82.05% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.22% | 97.33% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.18% | 98.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.76% | 95.56% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 82.69% | 85.31% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 82.33% | 85.00% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 82.28% | 96.25% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 82.23% | 98.03% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.97% | 92.50% |
| CHEMBL5028 | O14672 | ADAM10 | 80.59% | 97.50% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.58% | 100.00% |
| CHEMBL233 | P35372 | Mu opioid receptor | 80.52% | 97.93% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.46% | 95.83% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 80.43% | 96.11% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.36% | 97.28% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 80.06% | 97.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 11105289 |
| LOTUS | LTS0187316 |
| wikiData | Q425134 |