Palmaenone B
| Internal ID | 745d045a-767e-4c11-89ac-b6fceb9f1c96 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Alcohols and polyols > Tertiary alcohols |
| IUPAC Name | methyl (1S,5S)-3,5-dichloro-2-[(E)-1-chloroprop-1-enyl]-1-hydroxy-4-oxocyclopent-2-ene-1-carboxylate |
| SMILES (Canonical) | CC=C(C1=C(C(=O)C(C1(C(=O)OC)O)Cl)Cl)Cl |
| SMILES (Isomeric) | C/C=C(\C1=C(C(=O)[C@H]([C@]1(C(=O)OC)O)Cl)Cl)/Cl |
| InChI | InChI=1S/C10H9Cl3O4/c1-3-4(11)5-6(12)7(14)8(13)10(5,16)9(15)17-2/h3,8,16H,1-2H3/b4-3+/t8-,10-/m1/s1 |
| InChI Key | PSKFUYJUFHLCDN-KHSHYHJCSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C10H9Cl3O4 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 297.956642 g/mol |
| Topological Polar Surface Area (TPSA) | 63.60 Ų |
| XlogP | 1.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.66% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.40% | 94.45% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.79% | 91.19% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.37% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.85% | 96.09% |
| CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 82.45% | 97.53% |
| CHEMBL3242 | O43570 | Carbonic anhydrase XII | 81.61% | 97.37% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.28% | 91.07% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.65% | 86.92% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 80.31% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139586175 |
| LOTUS | LTS0094183 |
| wikiData | Q77500643 |