Paecilopeptin
| Internal ID | 071d6d84-110b-47ae-9e72-30894a451158 |
| Taxonomy | Organic acids and derivatives > Carboximidic acids and derivatives > Carboximidic acids |
| IUPAC Name | (2S)-2-acetamido-4-methyl-N-[(2S)-3-methyl-1-oxobutan-2-yl]pentanamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H24N2O3/c1-8(2)6-11(14-10(5)17)13(18)15-12(7-16)9(3)4/h7-9,11-12H,6H2,1-5H3,(H,14,17)(H,15,18)/t11-,12+/m0/s1 |
| InChI Key | FCSVBIFJBYWEQD-NWDGAFQWSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17869263 g/mol |
| Topological Polar Surface Area (TPSA) | 75.30 Ų |
| XlogP | 0.80 |
| CHEBI:66717 |
| Q27135340 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3837 | P07711 | Cathepsin L | 99.16% | 96.61% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.82% | 98.95% |
| CHEMBL4072 | P07858 | Cathepsin B | 93.75% | 93.67% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.05% | 93.56% |
| CHEMBL1801 | P00747 | Plasminogen | 92.84% | 92.44% |
| CHEMBL4801 | P29466 | Caspase-1 | 92.22% | 96.85% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.74% | 96.09% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 87.91% | 83.10% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 87.87% | 100.00% |
| CHEMBL268 | P43235 | Cathepsin K | 85.51% | 96.85% |
| CHEMBL3308 | P55212 | Caspase-6 | 85.25% | 97.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.68% | 99.17% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.58% | 90.17% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.06% | 89.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.41% | 96.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.60% | 94.33% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 82.08% | 98.05% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.16% | 91.11% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 80.52% | 98.33% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 80.08% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10038050 |
| LOTUS | LTS0083362 |
| wikiData | Q27135340 |