Paecilomycone A
| Internal ID | 2cdd5335-f05f-4c12-ae18-0c879e93cff8 |
| Taxonomy | Benzenoids > Phenalenes > Phenalenones |
| IUPAC Name | 6,7,8,9-tetrahydroxy-4-methoxy-3-methylphenalen-1-one |
| SMILES (Canonical) | CC1=CC(=O)C2=C(C(=C(C3=C2C1=C(C=C3O)OC)O)O)O |
| SMILES (Isomeric) | CC1=CC(=O)C2=C(C(=C(C3=C2C1=C(C=C3O)OC)O)O)O |
| InChI | InChI=1S/C15H12O6/c1-5-3-6(16)10-12-9(5)8(21-2)4-7(17)11(12)14(19)15(20)13(10)18/h3-4,17-20H,1-2H3 |
| InChI Key | ZHSASZRRQYGNQH-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.06338810 g/mol |
| Topological Polar Surface Area (TPSA) | 107.00 Ų |
| XlogP | 2.80 |
| SCHEMBL30664870 |
| CHEBI:210342 |
| 6,7,8,9-tetrahydroxy-4-methoxy-3-methylphenalen-1-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.28% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.91% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.57% | 85.14% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.26% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.55% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.55% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.61% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.96% | 98.75% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.56% | 99.15% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.37% | 99.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.34% | 90.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.57% | 94.45% |
| CHEMBL3194 | P02766 | Transthyretin | 84.17% | 90.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.74% | 89.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.92% | 95.50% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.99% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 13592175 |
| LOTUS | LTS0080972 |
| wikiData | Q77519771 |