Pacificin J
| Internal ID | a145b348-a93d-4a02-be93-0b109750bba0 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Alcohols and polyols > Tertiary alcohols |
| IUPAC Name | (E)-5-[(1S,2R,5E,10S)-2,5-dimethyl-9-methylidene-2-bicyclo[8.1.0]undec-5-enyl]-2-methylpent-3-en-2-ol |
| SMILES (Canonical) | CC1=CCCC(=C)C2CC2C(CC1)(C)CC=CC(C)(C)O |
| SMILES (Isomeric) | C/C/1=C\CCC(=C)[C@H]2C[C@@H]2[C@@](CC1)(C)C/C=C/C(C)(C)O |
| InChI | InChI=1S/C20H32O/c1-15-8-6-9-16(2)17-14-18(17)20(5,13-10-15)12-7-11-19(3,4)21/h7-8,11,17-18,21H,2,6,9-10,12-14H2,1,3-5H3/b11-7+,15-8+/t17-,18+,20+/m1/s1 |
| InChI Key | SPKCOCUHKUVJLN-JHKFPMARSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.50 g/mol |
| Exact Mass | 288.245315640 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 4.50 |
| CHEMBL505032 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.43% | 97.25% |
| CHEMBL240 | Q12809 | HERG | 97.24% | 89.76% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.08% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.25% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.26% | 97.09% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 89.22% | 97.64% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.02% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.01% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.85% | 86.33% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 83.47% | 97.79% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 83.18% | 90.93% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.46% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 21574271 |
| LOTUS | LTS0199161 |
| wikiData | Q105257427 |