Pacifibactin
| Internal ID | b4fa516d-2d6c-4f1f-8c3b-0274e60d90b9 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | (2S,3S)-4-[[(2R)-1-[[(2R,3R)-1-[[(2S)-1-[[(2S)-5-[acetyl(hydroxy)amino]-1-[[(3R)-1-hydroxy-2-oxopiperidin-3-yl]amino]-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-carboxy-3-hydroxy-1-oxopropan-2-yl]amino]-6-(diaminomethylideneamino)-1-oxohexan-2-yl]amino]-3-[(4-amino-3-hydroxypentanoyl)amino]-2-hydroxy-4-oxobutanoic acid |
| SMILES (Canonical) | CC(C(CC(=O)NC(C(C(=O)O)O)C(=O)NC(CCCCN=C(N)N)C(=O)NC(C(C(=O)O)O)C(=O)NC(CO)C(=O)NC(CCCN(C(=O)C)O)C(=O)NC1CCCN(C1=O)O)O)N |
| SMILES (Isomeric) | CC(C(CC(=O)N[C@@H]([C@@H](C(=O)O)O)C(=O)N[C@H](CCCCN=C(N)N)C(=O)N[C@H]([C@H](C(=O)O)O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN(C(=O)C)O)C(=O)N[C@@H]1CCCN(C1=O)O)O)N |
| InChI | InChI=1S/C35H60N12O18/c1-15(36)21(50)13-22(51)44-23(25(52)33(60)61)30(57)41-17(7-3-4-10-39-35(37)38)28(55)45-24(26(53)34(62)63)31(58)43-20(14-48)29(56)40-18(8-5-11-46(64)16(2)49)27(54)42-19-9-6-12-47(65)32(19)59/h15,17-21,23-26,48,50,52-53,64-65H,3-14,36H2,1-2H3,(H,40,56)(H,41,57)(H,42,54)(H,43,58)(H,44,51)(H,45,55)(H,60,61)(H,62,63)(H4,37,38,39)/t15?,17-,18+,19-,20+,21?,23+,24-,25+,26-/m1/s1 |
| InChI Key | DRKCOUTVBQFDMD-XRTXDQJLSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C35H60N12O18 |
| Molecular Weight | 936.90 g/mol |
| Exact Mass | 936.41485311 g/mol |
| Topological Polar Surface Area (TPSA) | 502.00 Ų |
| XlogP | -11.00 |
| Atomic LogP (AlogP) | -8.65 |
| H-Bond Acceptor | 18 |
| H-Bond Donor | 17 |
| Rotatable Bonds | 28 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.7509 | 75.09% |
| Caco-2 | - | 0.8612 | 86.12% |
| Blood Brain Barrier | - | 0.7500 | 75.00% |
| Human oral bioavailability | - | 0.6286 | 62.86% |
| Subcellular localzation | Mitochondria | 0.6464 | 64.64% |
| OATP2B1 inhibitior | - | 0.8595 | 85.95% |
| OATP1B1 inhibitior | + | 0.8735 | 87.35% |
| OATP1B3 inhibitior | + | 0.9373 | 93.73% |
| MATE1 inhibitior | - | 0.9000 | 90.00% |
| OCT2 inhibitior | - | 0.6500 | 65.00% |
| BSEP inhibitior | + | 0.7010 | 70.10% |
| P-glycoprotein inhibitior | + | 0.7379 | 73.79% |
| P-glycoprotein substrate | + | 0.8099 | 80.99% |
| CYP3A4 substrate | + | 0.7065 | 70.65% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8089 | 80.89% |
| CYP3A4 inhibition | - | 0.9545 | 95.45% |
| CYP2C9 inhibition | - | 0.8355 | 83.55% |
| CYP2C19 inhibition | - | 0.8194 | 81.94% |
| CYP2D6 inhibition | - | 0.8878 | 88.78% |
| CYP1A2 inhibition | - | 0.8444 | 84.44% |
| CYP2C8 inhibition | + | 0.4774 | 47.74% |
| CYP inhibitory promiscuity | - | 0.9926 | 99.26% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8000 | 80.00% |
| Carcinogenicity (trinary) | Non-required | 0.5002 | 50.02% |
| Eye corrosion | - | 0.9808 | 98.08% |
| Eye irritation | - | 0.8978 | 89.78% |
| Skin irritation | - | 0.7520 | 75.20% |
| Skin corrosion | - | 0.9196 | 91.96% |
| Ames mutagenesis | + | 0.5100 | 51.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4296 | 42.96% |
| Micronuclear | + | 0.8900 | 89.00% |
| Hepatotoxicity | + | 0.5003 | 50.03% |
| skin sensitisation | - | 0.8244 | 82.44% |
| Respiratory toxicity | + | 0.7444 | 74.44% |
| Reproductive toxicity | + | 0.8889 | 88.89% |
| Mitochondrial toxicity | + | 0.9000 | 90.00% |
| Nephrotoxicity | + | 0.7176 | 71.76% |
| Acute Oral Toxicity (c) | III | 0.5606 | 56.06% |
| Estrogen receptor binding | + | 0.7809 | 78.09% |
| Androgen receptor binding | + | 0.6503 | 65.03% |
| Thyroid receptor binding | + | 0.5237 | 52.37% |
| Glucocorticoid receptor binding | - | 0.4822 | 48.22% |
| Aromatase binding | + | 0.6471 | 64.71% |
| PPAR gamma | + | 0.7056 | 70.56% |
| Honey bee toxicity | - | 0.8153 | 81.53% |
| Biodegradation | - | 0.6750 | 67.50% |
| Crustacea aquatic toxicity | - | 0.6900 | 69.00% |
| Fish aquatic toxicity | - | 0.6888 | 68.88% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.74% | 98.95% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.64% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.99% | 96.09% |
| CHEMBL204 | P00734 | Thrombin | 97.51% | 96.01% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 96.55% | 93.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 96.52% | 98.33% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 95.51% | 100.00% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 95.36% | 94.66% |
| CHEMBL3837 | P07711 | Cathepsin L | 95.26% | 96.61% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 95.20% | 93.10% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 94.85% | 98.05% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.28% | 94.45% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.68% | 93.56% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.83% | 96.47% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 91.34% | 90.08% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.05% | 90.71% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.91% | 97.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.72% | 99.17% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 90.38% | 95.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.63% | 91.11% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 89.16% | 98.10% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.21% | 95.89% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 87.56% | 96.38% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 87.32% | 95.38% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 86.32% | 96.90% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 85.83% | 96.03% |
| CHEMBL4072 | P07858 | Cathepsin B | 85.70% | 93.67% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.62% | 91.19% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 85.48% | 98.77% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 85.19% | 96.11% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.02% | 95.50% |
| CHEMBL5028 | O14672 | ADAM10 | 84.99% | 97.50% |
| CHEMBL3776 | Q14790 | Caspase-8 | 84.97% | 97.06% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.72% | 95.56% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 84.69% | 100.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.06% | 95.89% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 84.01% | 96.31% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.48% | 100.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.06% | 90.17% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.96% | 93.03% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 82.81% | 97.50% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 81.80% | 97.29% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 81.55% | 97.86% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 81.52% | 92.12% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 81.02% | 93.33% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 80.65% | 95.36% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.40% | 99.23% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.26% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 145720824 |
| LOTUS | LTS0108260 |
| wikiData | Q104987449 |