p-Hydroxybenzyl glucosinolate
Internal ID | beab4b81-6f09-49b1-a7b3-bec7eb78c699 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glucosinolates > Alkylglucosinolates |
IUPAC Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1E)-2-(4-hydroxyphenyl)-N-sulfooxyethanimidothioate |
SMILES (Canonical) | C1=CC(=CC=C1CC(=NOS(=O)(=O)O)SC2C(C(C(C(O2)CO)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C/C(=N\OS(=O)(=O)O)/SC2C(C(C(C(O2)CO)O)O)O)O |
InChI | InChI=1S/C14H19NO10S2/c16-6-9-11(18)12(19)13(20)14(24-9)26-10(15-25-27(21,22)23)5-7-1-3-8(17)4-2-7/h1-4,9,11-14,16-20H,5-6H2,(H,21,22,23)/b15-10+ |
InChI Key | WWBNBPSEKLOHJU-XNTDXEJSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C14H19NO10S2 |
Molecular Weight | 425.40 g/mol |
Exact Mass | 425.04503815 g/mol |
Topological Polar Surface Area (TPSA) | 220.00 Ų |
XlogP | -0.60 |
p-Hydroxybenzyl glucosinolate |
SCHEMBL19671007 |
1-Thio-b-D-glucopyranose 1-[4-hydroxy-N-(sulfooxy)benzeneethanimidate] |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 95.45% | 98.95% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 93.64% | 95.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.11% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.76% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.84% | 94.73% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.41% | 91.11% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.80% | 95.89% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.88% | 86.92% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 87.80% | 85.31% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.13% | 94.45% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 86.72% | 89.67% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 86.10% | 83.57% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.80% | 97.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.50% | 94.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.55% | 96.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.79% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.03% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.88% | 96.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.21% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Brassica elongata |
Brassica juncea |
Brassica napus |
Lepidium meyenii |
Sinapis arvensis |
Strigosella africana |
PubChem | 9573049 |
LOTUS | LTS0134412 |
wikiData | Q104253632 |