Oxosarcophylline
| Internal ID | 6728d20b-7067-4c76-94b5-01af45d2e5df |
| Taxonomy | Organoheterocyclic compounds > Benzoxepines > Dibenzoxepines |
| IUPAC Name | 4,5-dimethoxy-2-oxa-11-azatetracyclo[8.7.1.03,8.014,18]octadeca-1(17),3(8),4,6,10,12,14(18),15-octaen-17-ol |
| SMILES (Canonical) | COC1=C(C2=C(CC3=NC=CC4=C3C(=C(C=C4)O)O2)C=C1)OC |
| SMILES (Isomeric) | COC1=C(C2=C(CC3=NC=CC4=C3C(=C(C=C4)O)O2)C=C1)OC |
| InChI | InChI=1S/C18H15NO4/c1-21-14-6-4-11-9-12-15-10(7-8-19-12)3-5-13(20)17(15)23-16(11)18(14)22-2/h3-8,20H,9H2,1-2H3 |
| InChI Key | KXPWCIFCBKXPIQ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.10010796 g/mol |
| Topological Polar Surface Area (TPSA) | 60.80 Ų |
| XlogP | 3.30 |
| CHEMBL452777 |
| BDBM50292462 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 99.30% | 91.49% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.06% | 83.82% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.73% | 94.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.96% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.99% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.98% | 98.75% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 89.66% | 93.10% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.43% | 99.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.05% | 90.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.75% | 86.33% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 88.12% | 94.03% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 87.71% | 98.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.37% | 99.15% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.34% | 89.62% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.87% | 94.45% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 84.59% | 95.78% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.42% | 92.94% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.31% | 99.23% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 83.20% | 95.12% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 81.93% | 82.67% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.38% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Sarcocapnos baetica |
| Sarcocapnos crassifolia |
| Sarcocapnos enneaphylla |
| PubChem | 44559881 |
| LOTUS | LTS0191071 |
| wikiData | Q104251712 |