Oxolupanine
| Internal ID | 5de6c67b-4920-40fc-8bd1-f7b39e1eef57 |
| Taxonomy | Alkaloids and derivatives > Lupin alkaloids > Sparteine, lupanine, and related alkaloids |
| IUPAC Name | 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-2-ene-6,8-dione |
| SMILES (Canonical) | C1CCN2CC3CC(C2C1)C(=O)N4C3=CCCC4=O |
| SMILES (Isomeric) | C1CCN2CC3CC(C2C1)C(=O)N4C3=CCCC4=O |
| InChI | InChI=1S/C15H20N2O2/c18-14-6-3-5-12-10-8-11(15(19)17(12)14)13-4-1-2-7-16(13)9-10/h5,10-11,13H,1-4,6-9H2 |
| InChI Key | HDEXKFWRBAIRHI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.152477885 g/mol |
| Topological Polar Surface Area (TPSA) | 40.60 Ų |
| XlogP | 0.80 |
| HDEXKFWRBAIRHI-UHFFFAOYSA-N |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 94.79% | 93.40% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 94.45% | 91.76% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.51% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.21% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.61% | 98.95% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.04% | 90.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.72% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.99% | 95.89% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.90% | 93.03% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.55% | 91.11% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.23% | 90.24% |
| CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 82.57% | 91.43% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.45% | 93.04% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 82.27% | 94.78% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.41% | 92.50% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.92% | 96.09% |
| CHEMBL1871 | P10275 | Androgen Receptor | 80.72% | 96.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Petteria ramentacea |
| PubChem | 91748409 |
| LOTUS | LTS0211968 |
| wikiData | Q105026309 |