(7S,10R)-7-benzyl-4-[(2R)-butan-2-yl]-10-methoxy-15-oxa-2,5,8-triazatricyclo[8.5.0.03,8]pentadeca-1,3,11,13-tetraene-6,9-dione
| Internal ID | c6f45d49-d4d8-405f-ba95-12b6a493db99 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives |
| IUPAC Name | (7S,10R)-7-benzyl-4-[(2R)-butan-2-yl]-10-methoxy-15-oxa-2,5,8-triazatricyclo[8.5.0.03,8]pentadeca-1,3,11,13-tetraene-6,9-dione |
| SMILES (Canonical) | CCC(C)C1=C2N=C3C(C=CC=CO3)(C(=O)N2C(C(=O)N1)CC4=CC=CC=C4)OC |
| SMILES (Isomeric) | CC[C@@H](C)C1=C2N=C3[C@](C=CC=CO3)(C(=O)N2[C@H](C(=O)N1)CC4=CC=CC=C4)OC |
| InChI | InChI=1S/C23H25N3O4/c1-4-15(2)18-19-25-21-23(29-3,12-8-9-13-30-21)22(28)26(19)17(20(27)24-18)14-16-10-6-5-7-11-16/h5-13,15,17H,4,14H2,1-3H3,(H,24,27)/t15-,17+,23-/m1/s1 |
| InChI Key | HFZOLZVOTSSKSM-LPXYKDPNSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.18450629 g/mol |
| Topological Polar Surface Area (TPSA) | 80.20 Ų |
| XlogP | 3.00 |
| Oxepinamide F |
| BDBM50524069 |
![2D Structure of (7S,10R)-7-benzyl-4-[(2R)-butan-2-yl]-10-methoxy-15-oxa-2,5,8-triazatricyclo[8.5.0.03,8]pentadeca-1,3,11,13-tetraene-6,9-dione](https://plantaedb.com/storage/docs/compounds/2023/11/oxepinamide-f.jpg "2D Structure of (7S,10R)-7-benzyl-4-[(2R)-butan-2-yl]-10-methoxy-15-oxa-2,5,8-triazatricyclo[8.5.0.03,8]pentadeca-1,3,11,13-tetraene-6,9-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.09% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.77% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.89% | 94.45% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.47% | 90.17% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.32% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.75% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.65% | 86.33% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.76% | 95.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.84% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.59% | 94.73% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.18% | 93.99% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.73% | 92.62% |
| CHEMBL4072 | P07858 | Cathepsin B | 81.76% | 93.67% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.50% | 94.00% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 81.49% | 97.64% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 80.34% | 95.34% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 80.17% | 89.44% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 51003508 |
| LOTUS | LTS0172657 |
| wikiData | Q77493862 |