Oxazolomycin A2
| Internal ID | b73493ca-5d0d-43c9-a083-08613d4fb566 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives |
| IUPAC Name | (2S,3S,4R)-3-hydroxy-3-[(1S,3R,4R)-4-hydroxy-9-[[(3R)-3-hydroxy-2,2,4-trimethyl-10-(1,3-oxazol-5-yl)deca-4,6,8-trienoyl]amino]-1-methoxy-3-methylnona-5,7-dienyl]-2-(hydroxymethyl)-1,4-dimethyl-5-oxopyrrolidine-2-carboxylic acid |
| SMILES (Canonical) | CC1C(=O)N(C(C1(C(CC(C)C(C=CC=CCNC(=O)C(C)(C)C(C(=CC=CC=CCC2=CN=CO2)C)O)O)OC)O)(CO)C(=O)O)C |
| SMILES (Isomeric) | C[C@H]1C(=O)N([C@]([C@@]1([C@H](C[C@@H](C)[C@H](C=CC=CCNC(=O)C(C)(C)[C@@H](C(=CC=CC=CCC2=CN=CO2)C)O)O)OC)O)(CO)C(=O)O)C |
| InChI | InChI=1S/C35H51N3O10/c1-23(15-11-8-9-12-16-26-20-36-22-48-26)29(41)33(4,5)31(43)37-18-14-10-13-17-27(40)24(2)19-28(47-7)35(46)25(3)30(42)38(6)34(35,21-39)32(44)45/h8-15,17,20,22,24-25,27-29,39-41,46H,16,18-19,21H2,1-7H3,(H,37,43)(H,44,45)/t24-,25+,27+,28+,29-,34-,35-/m1/s1 |
| InChI Key | JRRBOEASUSITIK-FCLWUBLVSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C35H51N3O10 |
| Molecular Weight | 673.80 g/mol |
| Exact Mass | 673.35744483 g/mol |
| Topological Polar Surface Area (TPSA) | 203.00 Ų |
| XlogP | 2.20 |
| (2S,3S,4R)-3-hydroxy-3-[(1S,3R,4R)-4-hydroxy-9-[[(3R)-3-hydroxy-2,2,4-trimethyl-10-(1,3-oxazol-5-yl)deca-4,6,8-trienoyl]amino]-1-methoxy-3-methylnona-5,7-dienyl]-2-(hydroxymethyl)-1,4-dimethyl-5-oxopyrrolidine-2-carboxylic acid |
| (2S,3S,4R)-3-((1S,3R,4R)-9-(((3R)-1,3-dihydroxy-2,2,4-trimethyl-10-(1,3-oxazol-5-yl)deca-4,6,8-trien-1-ylidene)amino)-4-hydroxy-1-methoxy-3-methylnona-5,7-dien-1-yl)-3-hydroxy-2-(hydroxymethyl)-1,4-dimethyl-5-oxopyrrolidine-2-carboxylate |
| (2S,3S,4R)-3-[(1S,3R,4R)-9-{[(3R)-1,3-dihydroxy-2,2,4-trimethyl-10-(1,3-oxazol-5-yl)deca-4,6,8-trien-1-ylidene]amino}-4-hydroxy-1-methoxy-3-methylnona-5,7-dien-1-yl]-3-hydroxy-2-(hydroxymethyl)-1,4-dimethyl-5-oxopyrrolidine-2-carboxylate |
| (2S,3S,4R)-3-hydroxy-3-((1S,3R,4R)-4-hydroxy-9-(((3R)-3-hydroxy-2,2,4-trimethyl-10-(1,3-oxazol-5-yl)deca-4,6,8-trienoyl)amino)-1-methoxy-3-methylnona-5,7-dienyl)-2-(hydroxymethyl)-1,4-dimethyl-5-oxopyrrolidine-2-carboxylic acid |
| RefChem:168876 |
| CHEBI:226459 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.55% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.92% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.44% | 96.09% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 94.62% | 98.59% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.68% | 97.25% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 91.76% | 96.90% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.24% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.14% | 96.00% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.93% | 83.82% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.14% | 91.07% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.95% | 91.11% |
| CHEMBL5028 | O14672 | ADAM10 | 86.12% | 97.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.95% | 99.23% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 85.49% | 89.34% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.01% | 89.00% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 84.59% | 94.50% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 84.40% | 95.71% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.00% | 100.00% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 83.13% | 96.25% |
| CHEMBL251 | P29274 | Adenosine A2a receptor | 82.20% | 94.40% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.86% | 95.71% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.16% | 99.17% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.14% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139589473 |
| LOTUS | LTS0069137 |
| wikiData | Q105134054 |