Oxaleimide A
| Internal ID | 85d81397-e5f5-4900-b812-9fde390081d3 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > 1,3-dicarbonyl compounds |
| IUPAC Name | (2R,4S,4aR,5R,6R,8aS)-4-methyl-5-[(3R,4S)-4-[(3S)-oct-1-en-3-yl]-2,5-dioxopyrrolidine-3-carbonyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,8a-octahydronaphthalene-2-carboxylic acid |
| SMILES (Canonical) | CCCCCC(C=C)C1C(C(=O)NC1=O)C(=O)C2C(C=CC3C2C(CC(C3)C(=O)O)C)C=CC |
| SMILES (Isomeric) | CCCCC[C@@H](C=C)[C@H]1[C@@H](C(=O)NC1=O)C(=O)[C@@H]2[C@@H](C=C[C@H]3[C@H]2[C@H](C[C@H](C3)C(=O)O)C)/C=C/C |
| InChI | InChI=1S/C28H39NO5/c1-5-8-9-11-17(7-3)23-24(27(32)29-26(23)31)25(30)22-18(10-6-2)12-13-19-15-20(28(33)34)14-16(4)21(19)22/h6-7,10,12-13,16-24H,3,5,8-9,11,14-15H2,1-2,4H3,(H,33,34)(H,29,31,32)/b10-6+/t16-,17+,18+,19+,20+,21+,22+,23-,24+/m0/s1 |
| InChI Key | PLNBIPHLIPNPLJ-YXTYEQIDSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C28H39NO5 |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.28282334 g/mol |
| Topological Polar Surface Area (TPSA) | 101.00 Ų |
| XlogP | 5.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.47% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.70% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.58% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.95% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.70% | 96.09% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.77% | 96.47% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.51% | 97.09% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.31% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.32% | 93.56% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 87.32% | 98.03% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.21% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.18% | 94.45% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.11% | 90.71% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.77% | 100.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.41% | 95.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.95% | 91.19% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 83.29% | 96.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.92% | 99.17% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 82.32% | 89.63% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146684540 |
| LOTUS | LTS0201086 |
| wikiData | Q105211044 |