Ovalichalcone A
Internal ID | f60209df-ebde-4359-91b8-d837ea0af4ed |
Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 3-prenylated chalcones |
IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-1-[2-hydroxy-4,6-dimethoxy-3-(3-methylbut-2-enyl)phenyl]prop-2-en-1-one |
SMILES (Canonical) | CC(=CCC1=C(C(=C(C=C1OC)OC)C(=O)C=CC2=CC3=C(C=C2)OCO3)O)C |
SMILES (Isomeric) | CC(=CCC1=C(C(=C(C=C1OC)OC)C(=O)/C=C/C2=CC3=C(C=C2)OCO3)O)C |
InChI | InChI=1S/C23H24O6/c1-14(2)5-8-16-19(26-3)12-21(27-4)22(23(16)25)17(24)9-6-15-7-10-18-20(11-15)29-13-28-18/h5-7,9-12,25H,8,13H2,1-4H3/b9-6+ |
InChI Key | YYYWPOYCOARRNU-RMKNXTFCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H24O6 |
Molecular Weight | 396.40 g/mol |
Exact Mass | 396.15728848 g/mol |
Topological Polar Surface Area (TPSA) | 74.20 Ų |
XlogP | 5.60 |
LMPK12120323 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.36% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.98% | 96.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.91% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.52% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.03% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.31% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.91% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 89.51% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.47% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.21% | 99.17% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 88.64% | 89.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.84% | 90.00% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 87.65% | 85.30% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.24% | 92.62% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.99% | 95.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.95% | 95.56% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.18% | 89.62% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 85.69% | 94.80% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 85.12% | 96.77% |
CHEMBL3194 | P02766 | Transthyretin | 83.26% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dahlstedtia pinnata |
PubChem | 6274715 |
LOTUS | LTS0206235 |
wikiData | Q105369024 |