Oscillatorin
| Internal ID | 4039e424-f9d3-4c33-b3d2-cfa160e07418 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 3-[(4S,10S,13S,16S,19S,25S,31S)-13-(2-amino-2-oxoethyl)-19-[3-(diaminomethylideneamino)propyl]-25-[(4-hydroxyphenyl)methyl]-42-(3-methylbut-2-enyl)-31-(2-methylpropyl)-2,5,11,14,17,20,23,26,29,32-decaoxo-4-propan-2-yl-3,6,12,15,18,21,24,27,30,33,35-undecazapentacyclo[31.10.0.06,10.034,42.036,41]tritetraconta-36,38,40-trien-16-yl]propanoic acid |
| SMILES (Canonical) | CC(C)CC1C(=O)N2C(CC3(C2NC4=CC=CC=C43)CC=C(C)C)C(=O)NC(C(=O)N5CCCC5C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NCC(=O)N1)CC6=CC=C(C=C6)O)CCCN=C(N)N)CCC(=O)O)CC(=O)N)C(C)C |
| SMILES (Isomeric) | CC(C)C[C@H]1C(=O)N2C(CC3(C2NC4=CC=CC=C43)CC=C(C)C)C(=O)N[C@H](C(=O)N5CCC[C@H]5C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)NCC(=O)N1)CC6=CC=C(C=C6)O)CCCN=C(N)N)CCC(=O)O)CC(=O)N)C(C)C |
| InChI | InChI=1S/C60H85N15O14/c1-31(2)21-22-60-28-44-55(87)73-49(33(5)6)57(89)74-24-10-14-43(74)54(86)71-41(27-45(61)77)53(85)70-39(19-20-48(80)81)52(84)69-38(13-9-23-64-59(62)63)50(82)65-29-46(78)67-40(26-34-15-17-35(76)18-16-34)51(83)66-30-47(79)68-42(25-32(3)4)56(88)75(44)58(60)72-37-12-8-7-11-36(37)60/h7-8,11-12,15-18,21,32-33,38-44,49,58,72,76H,9-10,13-14,19-20,22-30H2,1-6H3,(H2,61,77)(H,65,82)(H,66,83)(H,67,78)(H,68,79)(H,69,84)(H,70,85)(H,71,86)(H,73,87)(H,80,81)(H4,62,63,64)/t38-,39-,40-,41-,42-,43-,44?,49-,58?,60?/m0/s1 |
| InChI Key | VMYFCWSHTOSIJD-QYABUWCPSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C60H85N15O14 |
| Molecular Weight | 1240.40 g/mol |
| Exact Mass | 1239.64004244 g/mol |
| Topological Polar Surface Area (TPSA) | 451.00 Ų |
| XlogP | 0.80 |
| Atomic LogP (AlogP) | -1.78 |
| H-Bond Acceptor | 15 |
| H-Bond Donor | 14 |
| Rotatable Bonds | 16 |
| DTXSID301047682 |
| 3-[(4S,10S,13S,16S,19S,25S,31S)-13-(2-amino-2-oxoethyl)-19-[3-(diaminomethylideneamino)propyl]-25-[(4-hydroxyphenyl)methyl]-42-(3-methylbut-2-enyl)-31-(2-methylpropyl)-2,5,11,14,17,20,23,26,29,32-decaoxo-4-propan-2-yl-3,6,12,15,18,21,24,27,30,33,35-undecazapentacyclo[31.10.0.06,10.034,42.036,41]tritetraconta-36,38,40-trien-16-yl]propanoic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9546 | 95.46% |
| Caco-2 | - | 0.8673 | 86.73% |
| Blood Brain Barrier | - | 0.6250 | 62.50% |
| Human oral bioavailability | - | 0.7286 | 72.86% |
| Subcellular localzation | Mitochondria | 0.5643 | 56.43% |
| OATP2B1 inhibitior | - | 0.8587 | 85.87% |
| OATP1B1 inhibitior | + | 0.8308 | 83.08% |
| OATP1B3 inhibitior | + | 0.9312 | 93.12% |
| MATE1 inhibitior | - | 0.7600 | 76.00% |
| OCT2 inhibitior | - | 0.6750 | 67.50% |
| BSEP inhibitior | + | 0.9347 | 93.47% |
| P-glycoprotein inhibitior | + | 0.7440 | 74.40% |
| P-glycoprotein substrate | + | 0.8855 | 88.55% |
| CYP3A4 substrate | + | 0.7424 | 74.24% |
| CYP2C9 substrate | - | 0.6064 | 60.64% |
| CYP2D6 substrate | - | 0.8410 | 84.10% |
| CYP3A4 inhibition | - | 0.9103 | 91.03% |
| CYP2C9 inhibition | - | 0.7438 | 74.38% |
| CYP2C19 inhibition | - | 0.7243 | 72.43% |
| CYP2D6 inhibition | - | 0.8791 | 87.91% |
| CYP1A2 inhibition | - | 0.8215 | 82.15% |
| CYP2C8 inhibition | + | 0.8275 | 82.75% |
| CYP inhibitory promiscuity | - | 0.8579 | 85.79% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.9100 | 91.00% |
| Carcinogenicity (trinary) | Non-required | 0.5684 | 56.84% |
| Eye corrosion | - | 0.9830 | 98.30% |
| Eye irritation | - | 0.8975 | 89.75% |
| Skin irritation | - | 0.7560 | 75.60% |
| Skin corrosion | - | 0.9203 | 92.03% |
| Ames mutagenesis | - | 0.6100 | 61.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6478 | 64.78% |
| Micronuclear | + | 0.8500 | 85.00% |
| Hepatotoxicity | - | 0.5250 | 52.50% |
| skin sensitisation | - | 0.8335 | 83.35% |
| Respiratory toxicity | + | 0.8111 | 81.11% |
| Reproductive toxicity | + | 0.9444 | 94.44% |
| Mitochondrial toxicity | + | 0.9500 | 95.00% |
| Nephrotoxicity | + | 0.7186 | 71.86% |
| Acute Oral Toxicity (c) | III | 0.5519 | 55.19% |
| Estrogen receptor binding | + | 0.6718 | 67.18% |
| Androgen receptor binding | + | 0.7367 | 73.67% |
| Thyroid receptor binding | + | 0.6565 | 65.65% |
| Glucocorticoid receptor binding | + | 0.7125 | 71.25% |
| Aromatase binding | + | 0.7409 | 74.09% |
| PPAR gamma | + | 0.7527 | 75.27% |
| Honey bee toxicity | - | 0.6927 | 69.27% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | - | 0.6400 | 64.00% |
| Fish aquatic toxicity | + | 0.9866 | 98.66% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.90% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.59% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.48% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.32% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.82% | 94.45% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 97.65% | 93.00% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 96.33% | 82.38% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 96.01% | 97.05% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 96.01% | 92.97% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 95.96% | 95.89% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 94.56% | 90.08% |
| CHEMBL4071 | P08311 | Cathepsin G | 93.82% | 94.64% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.54% | 95.56% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 93.06% | 97.64% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 92.09% | 90.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.18% | 97.09% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.12% | 95.89% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 90.43% | 97.43% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.36% | 86.33% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 89.72% | 94.62% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.87% | 94.75% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 88.65% | 88.56% |
| CHEMBL204 | P00734 | Thrombin | 88.47% | 96.01% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.41% | 90.71% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.79% | 82.69% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 87.76% | 95.62% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.89% | 95.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.75% | 99.17% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 85.82% | 95.00% |
| CHEMBL4447 | Q9Y337 | Kallikrein 5 | 85.54% | 87.50% |
| CHEMBL236 | P41143 | Delta opioid receptor | 84.65% | 99.35% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.63% | 90.17% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 84.63% | 96.67% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 84.09% | 85.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.00% | 100.00% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 83.67% | 85.83% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.33% | 93.03% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 82.03% | 87.16% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.89% | 98.75% |
| CHEMBL228 | P31645 | Serotonin transporter | 81.73% | 95.51% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.56% | 97.14% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.23% | 96.90% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.57% | 95.50% |
| CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 80.52% | 99.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.26% | 90.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.19% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10034342 |
| LOTUS | LTS0129840 |
| wikiData | Q77279089 |