Orobanchol
Internal ID | 2a36fe54-5176-446d-8fe9-e8629de4c954 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Strigolactones |
IUPAC Name | (3E,3aS,4S,8bS)-4-hydroxy-8,8-dimethyl-3-[[(2R)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-3a,4,5,6,7,8b-hexahydroindeno[1,2-b]furan-2-one |
SMILES (Canonical) | CC1=CC(OC1=O)OC=C2C3C(C4=C(C3OC2=O)C(CCC4)(C)C)O |
SMILES (Isomeric) | CC1=C[C@@H](OC1=O)O/C=C/2\[C@H]3[C@@H](C4=C([C@H]3OC2=O)C(CCC4)(C)C)O |
InChI | InChI=1S/C19H22O6/c1-9-7-12(24-17(9)21)23-8-11-13-15(20)10-5-4-6-19(2,3)14(10)16(13)25-18(11)22/h7-8,12-13,15-16,20H,4-6H2,1-3H3/b11-8+/t12-,13+,15-,16+/m1/s1 |
InChI Key | CDBBMEYPRMUMTR-RZXXLYMMSA-N |
Popularity | 24 references in papers |
Molecular Formula | C19H22O6 |
Molecular Weight | 346.40 g/mol |
Exact Mass | 346.14163842 g/mol |
Topological Polar Surface Area (TPSA) | 82.10 Ų |
XlogP | 1.60 |
CHEMBL2270919 |
SCHEMBL13857704 |
(3E,3aS,4S,8bS)-4-hydroxy-8,8-dimethyl-3-[[(2R)-4-methyl-5-oxo-2H-furan-2-yl]oxymethylidene]-3a,4,5,6,7,8b-hexahydroindeno[1,2-b]furan-2-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.06% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.59% | 91.11% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 94.21% | 89.63% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.69% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.95% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.60% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.46% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.19% | 95.89% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.37% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.75% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.55% | 97.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.54% | 89.00% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.35% | 98.75% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.25% | 92.62% |
CHEMBL2581 | P07339 | Cathepsin D | 82.07% | 98.95% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.15% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Linum usitatissimum |
Orobanche minor |
Trifolium pratense |
PubChem | 10665247 |
LOTUS | LTS0274129 |
wikiData | Q104251482 |