Olvanil
Internal ID | a5a86c4b-d55d-4c86-ae1e-861a053eabde |
Taxonomy | Benzenoids > Phenols > Methoxyphenols |
IUPAC Name | (Z)-N-[(4-hydroxy-3-methoxyphenyl)methyl]octadec-9-enamide |
SMILES (Canonical) | CCCCCCCCC=CCCCCCCCC(=O)NCC1=CC(=C(C=C1)O)OC |
SMILES (Isomeric) | CCCCCCCC/C=C\CCCCCCCC(=O)NCC1=CC(=C(C=C1)O)OC |
InChI | InChI=1S/C26H43NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-26(29)27-22-23-19-20-24(28)25(21-23)30-2/h10-11,19-21,28H,3-9,12-18,22H2,1-2H3,(H,27,29)/b11-10- |
InChI Key | OPZKBPQVWDSATI-KHPPLWFESA-N |
Popularity | 173 references in papers |
Molecular Formula | C26H43NO3 |
Molecular Weight | 417.60 g/mol |
Exact Mass | 417.32429423 g/mol |
Topological Polar Surface Area (TPSA) | 58.60 Ų |
XlogP | 8.10 |
Atomic LogP (AlogP) | 7.05 |
H-Bond Acceptor | 3 |
H-Bond Donor | 2 |
Rotatable Bonds | 18 |
58493-49-5 |
N-Vanillyloleamide |
(Z)-N-[(4-hydroxy-3-methoxyphenyl)methyl]octadec-9-enamide |
Olvanilo |
Olvanilum |
TCMDC-124289 |
NE-19550 |
Olvanilum [Latin] |
Olvanilo [Spanish] |
NE 19550 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9961 | 99.61% |
Caco-2 | - | 0.7253 | 72.53% |
Blood Brain Barrier | + | 0.6750 | 67.50% |
Human oral bioavailability | - | 0.6000 | 60.00% |
Subcellular localzation | Mitochondria | 0.8878 | 88.78% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8449 | 84.49% |
OATP1B3 inhibitior | + | 0.9354 | 93.54% |
MATE1 inhibitior | - | 0.9000 | 90.00% |
OCT2 inhibitior | + | 0.8000 | 80.00% |
BSEP inhibitior | + | 0.8588 | 85.88% |
P-glycoprotein inhibitior | - | 0.4544 | 45.44% |
P-glycoprotein substrate | - | 0.6581 | 65.81% |
CYP3A4 substrate | + | 0.5453 | 54.53% |
CYP2C9 substrate | - | 0.5801 | 58.01% |
CYP2D6 substrate | - | 0.7800 | 78.00% |
CYP3A4 inhibition | + | 0.8279 | 82.79% |
CYP2C9 inhibition | - | 0.5089 | 50.89% |
CYP2C19 inhibition | - | 0.7215 | 72.15% |
CYP2D6 inhibition | + | 0.8932 | 89.32% |
CYP1A2 inhibition | + | 0.9483 | 94.83% |
CYP2C8 inhibition | + | 0.8979 | 89.79% |
CYP inhibitory promiscuity | - | 0.7440 | 74.40% |
UGT catelyzed | - | 0.5000 | 50.00% |
Carcinogenicity (binary) | - | 0.7843 | 78.43% |
Carcinogenicity (trinary) | Non-required | 0.7127 | 71.27% |
Eye corrosion | - | 0.9907 | 99.07% |
Eye irritation | - | 0.8411 | 84.11% |
Skin irritation | - | 0.5949 | 59.49% |
Skin corrosion | - | 0.9492 | 94.92% |
Ames mutagenesis | - | 0.7200 | 72.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7763 | 77.63% |
Micronuclear | - | 0.6200 | 62.00% |
Hepatotoxicity | - | 0.8165 | 81.65% |
skin sensitisation | - | 0.8499 | 84.99% |
Respiratory toxicity | - | 0.5444 | 54.44% |
Reproductive toxicity | + | 0.8444 | 84.44% |
Mitochondrial toxicity | + | 0.6875 | 68.75% |
Nephrotoxicity | - | 0.8779 | 87.79% |
Acute Oral Toxicity (c) | III | 0.6302 | 63.02% |
Estrogen receptor binding | + | 0.7608 | 76.08% |
Androgen receptor binding | - | 0.5949 | 59.49% |
Thyroid receptor binding | - | 0.5000 | 50.00% |
Glucocorticoid receptor binding | - | 0.4741 | 47.41% |
Aromatase binding | - | 0.7021 | 70.21% |
PPAR gamma | - | 0.5384 | 53.84% |
Honey bee toxicity | - | 0.9532 | 95.32% |
Biodegradation | - | 0.6500 | 65.00% |
Crustacea aquatic toxicity | + | 0.8478 | 84.78% |
Fish aquatic toxicity | + | 0.9056 | 90.56% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
25118.9 nM |
Potency |
via CMAUP
|
CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
31622.8 nM 31622.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
19952.62 nM |
AC50 |
via CMAUP
|
CHEMBL289 | P10635 | Cytochrome P450 2D6 |
3162.28 nM |
AC50 |
via CMAUP
|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
10000 nM 10000 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
3548.1 nM 15848.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR |
1648.2 nM 13091.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL4794 | Q8NER1 | Vanilloid receptor |
0.5012 nM |
EC50 |
PMID: 12166946
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 99.61% | 99.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.41% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.88% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.47% | 96.09% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 96.32% | 92.08% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 92.45% | 97.29% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.07% | 94.45% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 92.00% | 90.20% |
CHEMBL2535 | P11166 | Glucose transporter | 90.60% | 98.75% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 89.22% | 98.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.91% | 95.56% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.94% | 96.95% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.27% | 95.50% |
CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 84.27% | 96.67% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.84% | 96.00% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.18% | 92.88% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 81.83% | 97.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.81% | 90.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 81.51% | 95.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.25% | 94.73% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.89% | 92.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.69% | 86.33% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.65% | 97.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Capsicum annuum |
PubChem | 5311093 |
NPASS | NPC6854 |
ChEMBL | CHEMBL76903 |