Ogipeptin A
| Internal ID | c781ed73-d1af-4285-bba5-3f4d2347828d |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
| IUPAC Name | N-[(3S,6S,9S,12S,15S,21S,22R)-15-(2-aminoethyl)-6-[(1R)-2-amino-1-hydroxyethyl]-3-[(1S)-2-amino-1-hydroxyethyl]-9-[3-(diaminomethylideneamino)propyl]-18-ethylidene-22-hydroxy-12-(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptazacyclotricos-21-yl]decanamide |
| SMILES (Canonical) | CCCCCCCCCC(=O)NC1C(CNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(=CC)NC1=O)CCN)CC(C)C)CCCN=C(N)N)C(CN)O)C(CN)O)O |
| SMILES (Isomeric) | CCCCCCCCCC(=O)N[C@H]1[C@@H](CNC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)C(=CC)NC1=O)CCN)CC(C)C)CCCN=C(N)N)[C@@H](CN)O)[C@H](CN)O)O |
| InChI | InChI=1S/C42H78N14O11/c1-5-7-8-9-10-11-12-15-31(60)54-34-30(59)22-49-39(65)32(28(57)20-44)56-41(67)33(29(58)21-45)55-37(63)25(14-13-18-48-42(46)47)51-38(64)27(19-23(3)4)53-36(62)26(16-17-43)52-35(61)24(6-2)50-40(34)66/h6,23,25-30,32-34,57-59H,5,7-22,43-45H2,1-4H3,(H,49,65)(H,50,66)(H,51,64)(H,52,61)(H,53,62)(H,54,60)(H,55,63)(H,56,67)(H4,46,47,48)/t25-,26-,27-,28-,29+,30+,32-,33-,34-/m0/s1 |
| InChI Key | VMDXXLVULZDQNB-ZBQMFOSJSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C42H78N14O11 |
| Molecular Weight | 955.20 g/mol |
| Exact Mass | 954.59744936 g/mol |
| Topological Polar Surface Area (TPSA) | 436.00 Ų |
| XlogP | -2.50 |
| Atomic LogP (AlogP) | -5.37 |
| H-Bond Acceptor | 15 |
| H-Bond Donor | 16 |
| Rotatable Bonds | 21 |
| N-[(3S,6S,9S,12S,15S,21S,22R)-15-(2-aminoethyl)-6-[(1R)-2-amino-1-hydroxyethyl]-3-[(1S)-2-amino-1-hydroxyethyl]-9-[3-(diaminomethylideneamino)propyl]-18-ethylidene-22-hydroxy-12-(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptazacyclotricos-21-yl]decanamide |
| N-((3S,6S,9S,12S,15S,21S,22R)-15-(2-aminoethyl)-6-((1R)-2-amino-1-hydroxyethyl)-3-((1S)-2-amino-1-hydroxyethyl)-9-(3-(diaminomethylideneamino)propyl)-18-ethylidene-22-hydroxy-12-(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptazacyclotricos-21-yl)decanamide |
| N-((3S,6S,9S,12S,15S,21S,22R)-6-((1R)-2-Amino-1-hydroxyethyl)-3-((1S)-2-amino-1-hydroxyethyl)-15-(2-aminoethyl)-9-(3-carbamimidamidopropyl)-18-ethylidene-2,5,8,11,14,17,20,22-octahydroxy-12-(2-methylpropyl)-1,4,7,10,13,16,19-heptaazacyclotricosa-1,4,7,10,13,16,19-heptaen-21-yl)decanimidate |
| N-[(3S,6S,9S,12S,15S,21S,22R)-6-[(1R)-2-Amino-1-hydroxyethyl]-3-[(1S)-2-amino-1-hydroxyethyl]-15-(2-aminoethyl)-9-(3-carbamimidamidopropyl)-18-ethylidene-2,5,8,11,14,17,20,22-octahydroxy-12-(2-methylpropyl)-1,4,7,10,13,16,19-heptaazacyclotricosa-1,4,7,10,13,16,19-heptaen-21-yl]decanimidate |
| RefChem:167978 |
| CHEBI:225683 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8098 | 80.98% |
| Caco-2 | - | 0.8627 | 86.27% |
| Blood Brain Barrier | - | 0.7500 | 75.00% |
| Human oral bioavailability | - | 0.6143 | 61.43% |
| Subcellular localzation | Mitochondria | 0.6811 | 68.11% |
| OATP2B1 inhibitior | - | 0.8584 | 85.84% |
| OATP1B1 inhibitior | + | 0.8262 | 82.62% |
| OATP1B3 inhibitior | + | 0.9248 | 92.48% |
| MATE1 inhibitior | - | 0.8600 | 86.00% |
| OCT2 inhibitior | - | 0.8000 | 80.00% |
| BSEP inhibitior | + | 0.7745 | 77.45% |
| P-glycoprotein inhibitior | + | 0.7406 | 74.06% |
| P-glycoprotein substrate | + | 0.8701 | 87.01% |
| CYP3A4 substrate | + | 0.6955 | 69.55% |
| CYP2C9 substrate | - | 0.6060 | 60.60% |
| CYP2D6 substrate | - | 0.8163 | 81.63% |
| CYP3A4 inhibition | - | 0.8852 | 88.52% |
| CYP2C9 inhibition | - | 0.8369 | 83.69% |
| CYP2C19 inhibition | - | 0.8136 | 81.36% |
| CYP2D6 inhibition | - | 0.8978 | 89.78% |
| CYP1A2 inhibition | - | 0.8568 | 85.68% |
| CYP2C8 inhibition | + | 0.6613 | 66.13% |
| CYP inhibitory promiscuity | - | 0.9873 | 98.73% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.8800 | 88.00% |
| Carcinogenicity (trinary) | Non-required | 0.5712 | 57.12% |
| Eye corrosion | - | 0.9811 | 98.11% |
| Eye irritation | - | 0.8997 | 89.97% |
| Skin irritation | - | 0.7514 | 75.14% |
| Skin corrosion | - | 0.9127 | 91.27% |
| Ames mutagenesis | - | 0.6470 | 64.70% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4443 | 44.43% |
| Micronuclear | + | 0.7200 | 72.00% |
| Hepatotoxicity | - | 0.6626 | 66.26% |
| skin sensitisation | - | 0.8275 | 82.75% |
| Respiratory toxicity | + | 0.7889 | 78.89% |
| Reproductive toxicity | + | 0.8444 | 84.44% |
| Mitochondrial toxicity | + | 0.7250 | 72.50% |
| Nephrotoxicity | + | 0.8424 | 84.24% |
| Acute Oral Toxicity (c) | III | 0.6349 | 63.49% |
| Estrogen receptor binding | + | 0.7793 | 77.93% |
| Androgen receptor binding | + | 0.6087 | 60.87% |
| Thyroid receptor binding | - | 0.5132 | 51.32% |
| Glucocorticoid receptor binding | - | 0.5000 | 50.00% |
| Aromatase binding | + | 0.6708 | 67.08% |
| PPAR gamma | + | 0.7340 | 73.40% |
| Honey bee toxicity | - | 0.7834 | 78.34% |
| Biodegradation | - | 0.7750 | 77.50% |
| Crustacea aquatic toxicity | + | 0.6124 | 61.24% |
| Fish aquatic toxicity | + | 0.6551 | 65.51% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.81% | 83.82% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.64% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.50% | 96.09% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 99.46% | 98.03% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 98.63% | 89.63% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.11% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.89% | 98.95% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 96.77% | 92.88% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.11% | 97.09% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 95.00% | 96.61% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 94.95% | 97.79% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.92% | 90.71% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.89% | 97.25% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 93.78% | 96.47% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.43% | 90.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.19% | 99.17% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 93.02% | 97.29% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 91.51% | 96.11% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 90.65% | 95.71% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 90.54% | 91.03% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 89.62% | 96.90% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.36% | 100.00% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 88.35% | 92.32% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.93% | 100.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 87.79% | 98.59% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 87.52% | 91.38% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 87.44% | 92.86% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.34% | 85.14% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 87.23% | 90.08% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.96% | 91.24% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.76% | 93.03% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 86.32% | 95.58% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.28% | 95.50% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 86.18% | 89.34% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.23% | 94.75% |
| CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 85.03% | 95.20% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 84.73% | 94.66% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 84.41% | 96.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.34% | 82.69% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.77% | 98.75% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.55% | 93.18% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 81.78% | 83.10% |
| CHEMBL222 | P23975 | Norepinephrine transporter | 81.76% | 96.06% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 81.70% | 95.00% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.95% | 100.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 80.60% | 95.93% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.17% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139589390 |
| LOTUS | LTS0260763 |
| wikiData | Q105288929 |