Odoamide
| Internal ID | 752e45f3-9de7-47c6-918b-f2495423c267 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (3S,6S,12R,15S,18R,21E,24S,25S,26R)-12-benzyl-6,18-bis[(2S)-butan-2-yl]-24-hydroxy-3,4,10,13,15,21,25-heptamethyl-26-[(2S)-pentan-2-yl]-1,19-dioxa-4,7,10,13,16-pentazacyclohexacos-21-ene-2,5,8,11,14,17,20-heptone |
| SMILES (Canonical) | CCCC(C)C1C(C(CC=C(C(=O)OC(C(=O)NC(C(=O)N(C(C(=O)N(CC(=O)NC(C(=O)N(C(C(=O)O1)C)C)C(C)CC)C)CC2=CC=CC=C2)C)C)C(C)CC)C)O)C |
| SMILES (Isomeric) | CCC[C@H](C)[C@@H]1[C@H]([C@H](C/C=C(/C(=O)O[C@@H](C(=O)N[C@H](C(=O)N([C@@H](C(=O)N(CC(=O)N[C@H](C(=O)N([C@H](C(=O)O1)C)C)[C@@H](C)CC)C)CC2=CC=CC=C2)C)C)[C@@H](C)CC)\C)O)C |
| InChI | InChI=1S/C46H73N5O10/c1-14-20-29(6)39-31(8)36(52)24-23-30(7)45(58)61-40(28(5)16-3)41(54)47-32(9)42(55)51(13)35(25-34-21-18-17-19-22-34)43(56)49(11)26-37(53)48-38(27(4)15-2)44(57)50(12)33(10)46(59)60-39/h17-19,21-23,27-29,31-33,35-36,38-40,52H,14-16,20,24-26H2,1-13H3,(H,47,54)(H,48,53)/b30-23+/t27-,28-,29-,31-,32-,33-,35+,36-,38-,39+,40+/m0/s1 |
| InChI Key | YJQOYCXXISGMIG-LVAZOHBQSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C46H73N5O10 |
| Molecular Weight | 856.10 g/mol |
| Exact Mass | 855.53574354 g/mol |
| Topological Polar Surface Area (TPSA) | 192.00 Ų |
| XlogP | 7.00 |
| CHEMBL4173882 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.70% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.58% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.65% | 90.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.28% | 95.56% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 93.44% | 93.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.76% | 85.14% |
| CHEMBL1949 | P62937 | Cyclophilin A | 89.43% | 98.57% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.87% | 94.45% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 88.63% | 97.64% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.48% | 93.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.32% | 97.25% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.72% | 94.73% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.67% | 95.50% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.37% | 90.71% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 85.55% | 85.94% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.12% | 96.47% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.38% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.71% | 89.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.97% | 93.99% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.38% | 91.71% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.16% | 90.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139590176 |
| LOTUS | LTS0186678 |
| wikiData | Q105349401 |