Odilorhabdin NOSO-95B
| Internal ID | df2ba9df-f771-4bfc-9ff4-a521e3a141ff |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides |
| IUPAC Name | (2S)-N-[(2S)-1-[[(2S,5S)-6-amino-1-[[(Z)-1-[[(2S)-6-amino-1-(4-aminobutylamino)-1-oxohexan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopent-2-en-2-yl]amino]-5-hydroxy-1-oxohexan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-1-[(2R)-5-amino-2-[[2-[[(2S,3S)-4-amino-2-[[(2S,3S)-4-amino-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]acetyl]amino]pentanoyl]pyrrolidine-2-carboxamide |
| SMILES (Canonical) | C1CC(N(C1)C(=O)C(CCCN)NC(=O)CNC(=O)C(C(CN)O)NC(=O)C(C(CN)O)NC(=O)C(CCCCN)N)C(=O)NC(CC2=CN=CN2)C(=O)NC(CCC(CN)O)C(=O)NC(=CCCN=C(N)N)C(=O)NC(CCCCN)C(=O)NCCCCN |
| SMILES (Isomeric) | C1C[C@H](N(C1)C(=O)[C@@H](CCCN)NC(=O)CNC(=O)[C@H]([C@H](CN)O)NC(=O)[C@H]([C@H](CN)O)NC(=O)[C@H](CCCCN)N)C(=O)N[C@@H](CC2=CN=CN2)C(=O)N[C@@H](CC[C@@H](CN)O)C(=O)N/C(=C\CCN=C(N)N)/C(=O)N[C@@H](CCCCN)C(=O)NCCCCN |
| InChI | InChI=1S/C54H101N23O13/c55-17-3-1-10-33(62)45(82)75-44(41(80)27-61)52(89)76-43(40(79)26-60)51(88)68-29-42(81)70-37(12-7-20-58)53(90)77-23-9-14-39(77)50(87)74-38(24-31-28-65-30-69-31)49(86)73-36(16-15-32(78)25-59)48(85)72-35(13-8-22-67-54(63)64)47(84)71-34(11-2-4-18-56)46(83)66-21-6-5-19-57/h13,28,30,32-34,36-41,43-44,78-80H,1-12,14-27,29,55-62H2,(H,65,69)(H,66,83)(H,68,88)(H,70,81)(H,71,84)(H,72,85)(H,73,86)(H,74,87)(H,75,82)(H,76,89)(H4,63,64,67)/b35-13-/t32-,33-,34-,36-,37+,38-,39-,40-,41-,43-,44-/m0/s1 |
| InChI Key | UYHIETONVGCMMA-CCUWYPMBSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C54H101N23O13 |
| Molecular Weight | 1280.50 g/mol |
| Exact Mass | 1279.79492037 g/mol |
| Topological Polar Surface Area (TPSA) | 644.00 Ų |
| XlogP | -11.10 |
| Atomic LogP (AlogP) | -10.45 |
| H-Bond Acceptor | 23 |
| H-Bond Donor | 23 |
| Rotatable Bonds | 46 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7779 | 77.79% |
| Caco-2 | - | 0.8607 | 86.07% |
| Blood Brain Barrier | - | 0.5000 | 50.00% |
| Human oral bioavailability | - | 0.6286 | 62.86% |
| Subcellular localzation | Mitochondria | 0.7331 | 73.31% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8010 | 80.10% |
| OATP1B3 inhibitior | + | 0.9370 | 93.70% |
| MATE1 inhibitior | - | 0.7009 | 70.09% |
| OCT2 inhibitior | - | 0.6000 | 60.00% |
| BSEP inhibitior | + | 0.9531 | 95.31% |
| P-glycoprotein inhibitior | + | 0.7423 | 74.23% |
| P-glycoprotein substrate | + | 0.8527 | 85.27% |
| CYP3A4 substrate | + | 0.7407 | 74.07% |
| CYP2C9 substrate | - | 0.8055 | 80.55% |
| CYP2D6 substrate | - | 0.8108 | 81.08% |
| CYP3A4 inhibition | - | 0.8305 | 83.05% |
| CYP2C9 inhibition | - | 0.8728 | 87.28% |
| CYP2C19 inhibition | - | 0.8123 | 81.23% |
| CYP2D6 inhibition | - | 0.8916 | 89.16% |
| CYP1A2 inhibition | - | 0.7875 | 78.75% |
| CYP2C8 inhibition | + | 0.8034 | 80.34% |
| CYP inhibitory promiscuity | - | 0.9774 | 97.74% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.9200 | 92.00% |
| Carcinogenicity (trinary) | Non-required | 0.5411 | 54.11% |
| Eye corrosion | - | 0.9847 | 98.47% |
| Eye irritation | - | 0.8961 | 89.61% |
| Skin irritation | - | 0.7337 | 73.37% |
| Skin corrosion | - | 0.9161 | 91.61% |
| Ames mutagenesis | - | 0.5554 | 55.54% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6740 | 67.40% |
| Micronuclear | + | 0.8800 | 88.00% |
| Hepatotoxicity | - | 0.6125 | 61.25% |
| skin sensitisation | - | 0.8375 | 83.75% |
| Respiratory toxicity | + | 0.8444 | 84.44% |
| Reproductive toxicity | + | 0.9333 | 93.33% |
| Mitochondrial toxicity | + | 0.7625 | 76.25% |
| Nephrotoxicity | - | 0.9015 | 90.15% |
| Acute Oral Toxicity (c) | III | 0.6029 | 60.29% |
| Estrogen receptor binding | + | 0.6236 | 62.36% |
| Androgen receptor binding | + | 0.6896 | 68.96% |
| Thyroid receptor binding | + | 0.6173 | 61.73% |
| Glucocorticoid receptor binding | + | 0.6696 | 66.96% |
| Aromatase binding | + | 0.7339 | 73.39% |
| PPAR gamma | + | 0.6733 | 67.33% |
| Honey bee toxicity | - | 0.6939 | 69.39% |
| Biodegradation | - | 0.8000 | 80.00% |
| Crustacea aquatic toxicity | - | 0.5000 | 50.00% |
| Fish aquatic toxicity | - | 0.7297 | 72.97% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 99.76% | 98.33% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 99.56% | 89.63% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.48% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.48% | 96.09% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 99.13% | 100.00% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 99.05% | 97.23% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.50% | 91.11% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 98.46% | 88.42% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 98.29% | 96.67% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.68% | 97.09% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 97.56% | 98.94% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 96.56% | 96.67% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 96.38% | 98.24% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 95.78% | 97.21% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 95.72% | 97.64% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 95.64% | 90.20% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 95.57% | 95.52% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 95.45% | 82.69% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.07% | 94.45% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 95.01% | 98.10% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 94.47% | 96.28% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 94.25% | 100.00% |
| CHEMBL233 | P35372 | Mu opioid receptor | 93.85% | 97.93% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 93.48% | 82.86% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 93.43% | 98.05% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 92.57% | 96.90% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.00% | 99.17% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 91.99% | 94.55% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 91.99% | 93.33% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 91.86% | 93.10% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.82% | 98.75% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 91.55% | 92.38% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.16% | 90.71% |
| CHEMBL249 | P25103 | Neurokinin 1 receptor | 91.04% | 99.17% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 90.91% | 100.00% |
| CHEMBL236 | P41143 | Delta opioid receptor | 90.76% | 99.35% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 90.67% | 91.81% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 90.21% | 93.18% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 90.10% | 94.00% |
| CHEMBL1795117 | Q8TEK3 | Histone-lysine N-methyltransferase, H3 lysine-79 specific | 89.87% | 93.56% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 89.81% | 95.56% |
| CHEMBL3018 | Q9Y5Y6 | Matriptase | 89.70% | 98.33% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 89.24% | 95.00% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 89.12% | 90.08% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 89.03% | 91.38% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.86% | 95.89% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 88.81% | 96.11% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 88.79% | 94.66% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 88.50% | 80.71% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.43% | 96.00% |
| CHEMBL3837 | P07711 | Cathepsin L | 88.39% | 96.61% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 88.07% | 93.03% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 87.16% | 94.78% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 86.58% | 88.56% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 86.52% | 96.03% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 85.88% | 96.25% |
| CHEMBL4625 | Q07817 | Apoptosis regulator Bcl-X | 85.75% | 99.77% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.64% | 93.00% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 85.32% | 85.31% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.22% | 93.56% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.11% | 95.89% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 84.96% | 98.89% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 84.71% | 95.92% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 84.68% | 95.17% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 84.28% | 98.59% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.88% | 90.24% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.81% | 90.00% |
| CHEMBL4578 | Q14680 | Maternal embryonic leucine zipper kinase | 83.80% | 81.58% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 83.69% | 95.58% |
| CHEMBL204 | P00734 | Thrombin | 83.30% | 96.01% |
| CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 82.66% | 95.20% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 81.85% | 82.38% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.71% | 95.50% |
| CHEMBL5646 | Q6L5J4 | FML2_HUMAN | 81.27% | 100.00% |
| CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 81.13% | 82.50% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 81.02% | 92.88% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 80.99% | 97.50% |
| CHEMBL5028 | O14672 | ADAM10 | 80.70% | 97.50% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.54% | 100.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.14% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146684504 |
| LOTUS | LTS0240400 |
| wikiData | Q105281468 |