octanoyl-Gly-DL-Ala-DL-Leu-DL-Iva-DL-Ser-DL-xiIle-DL-Leu-OH
| Internal ID | ff85b309-cb78-4506-b651-aa85f091c7d7 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 2-[[2-[[3-hydroxy-2-[[2-methyl-2-[[4-methyl-2-[2-[[2-(octanoylamino)acetyl]amino]propanoylamino]pentanoyl]amino]butanoyl]amino]propanoyl]amino]-3-methylpentanoyl]amino]-4-methylpentanoic acid |
| SMILES (Canonical) | CCCCCCCC(=O)NCC(=O)NC(C)C(=O)NC(CC(C)C)C(=O)NC(C)(CC)C(=O)NC(CO)C(=O)NC(C(C)CC)C(=O)NC(CC(C)C)C(=O)O |
| SMILES (Isomeric) | CCCCCCCC(=O)NCC(=O)NC(C)C(=O)NC(CC(C)C)C(=O)NC(C)(CC)C(=O)NC(CO)C(=O)NC(C(C)CC)C(=O)NC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C39H71N7O10/c1-11-14-15-16-17-18-30(48)40-21-31(49)41-26(9)33(50)42-27(19-23(4)5)35(52)46-39(10,13-3)38(56)44-29(22-47)34(51)45-32(25(8)12-2)36(53)43-28(37(54)55)20-24(6)7/h23-29,32,47H,11-22H2,1-10H3,(H,40,48)(H,41,49)(H,42,50)(H,43,53)(H,44,56)(H,45,51)(H,46,52)(H,54,55) |
| InChI Key | DOMYSMOQEWPFFE-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C39H71N7O10 |
| Molecular Weight | 798.00 g/mol |
| Exact Mass | 797.52624149 g/mol |
| Topological Polar Surface Area (TPSA) | 261.00 Ų |
| XlogP | 4.20 |
| Atomic LogP (AlogP) | 1.41 |
| H-Bond Acceptor | 9 |
| H-Bond Donor | 9 |
| Rotatable Bonds | 28 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6656 | 66.56% |
| Caco-2 | - | 0.8567 | 85.67% |
| Blood Brain Barrier | + | 0.6000 | 60.00% |
| Human oral bioavailability | - | 0.7571 | 75.71% |
| Subcellular localzation | Mitochondria | 0.5919 | 59.19% |
| OATP2B1 inhibitior | - | 0.7201 | 72.01% |
| OATP1B1 inhibitior | + | 0.8435 | 84.35% |
| OATP1B3 inhibitior | + | 0.9265 | 92.65% |
| MATE1 inhibitior | - | 0.9800 | 98.00% |
| OCT2 inhibitior | - | 0.9250 | 92.50% |
| BSEP inhibitior | + | 0.8033 | 80.33% |
| P-glycoprotein inhibitior | + | 0.7352 | 73.52% |
| P-glycoprotein substrate | + | 0.7504 | 75.04% |
| CYP3A4 substrate | + | 0.6594 | 65.94% |
| CYP2C9 substrate | + | 0.6356 | 63.56% |
| CYP2D6 substrate | - | 0.8737 | 87.37% |
| CYP3A4 inhibition | - | 0.8397 | 83.97% |
| CYP2C9 inhibition | - | 0.8922 | 89.22% |
| CYP2C19 inhibition | - | 0.8606 | 86.06% |
| CYP2D6 inhibition | - | 0.8816 | 88.16% |
| CYP1A2 inhibition | - | 0.8919 | 89.19% |
| CYP2C8 inhibition | + | 0.4817 | 48.17% |
| CYP inhibitory promiscuity | - | 0.9400 | 94.00% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.8500 | 85.00% |
| Carcinogenicity (trinary) | Non-required | 0.6356 | 63.56% |
| Eye corrosion | - | 0.9745 | 97.45% |
| Eye irritation | - | 0.9020 | 90.20% |
| Skin irritation | - | 0.8472 | 84.72% |
| Skin corrosion | - | 0.9732 | 97.32% |
| Ames mutagenesis | - | 0.8900 | 89.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4791 | 47.91% |
| Micronuclear | + | 0.5300 | 53.00% |
| Hepatotoxicity | + | 0.5868 | 58.68% |
| skin sensitisation | - | 0.8630 | 86.30% |
| Respiratory toxicity | - | 0.5222 | 52.22% |
| Reproductive toxicity | - | 0.6608 | 66.08% |
| Mitochondrial toxicity | - | 0.7375 | 73.75% |
| Nephrotoxicity | - | 0.6057 | 60.57% |
| Acute Oral Toxicity (c) | III | 0.6717 | 67.17% |
| Estrogen receptor binding | + | 0.7898 | 78.98% |
| Androgen receptor binding | + | 0.6392 | 63.92% |
| Thyroid receptor binding | + | 0.5312 | 53.12% |
| Glucocorticoid receptor binding | + | 0.5758 | 57.58% |
| Aromatase binding | + | 0.6602 | 66.02% |
| PPAR gamma | + | 0.6822 | 68.22% |
| Honey bee toxicity | - | 0.8797 | 87.97% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | + | 0.5969 | 59.69% |
| Fish aquatic toxicity | + | 0.7508 | 75.08% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 99.93% | 89.63% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.90% | 98.95% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 98.91% | 93.56% |
| CHEMBL3837 | P07711 | Cathepsin L | 98.87% | 96.61% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 98.67% | 97.29% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.90% | 99.17% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 97.71% | 100.00% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 96.31% | 98.94% |
| CHEMBL236 | P41143 | Delta opioid receptor | 95.74% | 99.35% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 94.80% | 100.00% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 94.41% | 97.23% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 93.38% | 98.03% |
| CHEMBL5979 | P05186 | Alkaline phosphatase, tissue-nonspecific isozyme | 93.19% | 85.40% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 92.55% | 98.89% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 92.18% | 96.67% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 92.07% | 85.94% |
| CHEMBL5285 | Q99683 | Mitogen-activated protein kinase kinase kinase 5 | 91.96% | 92.26% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 91.56% | 100.00% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 91.13% | 89.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.05% | 96.09% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 91.04% | 92.08% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 90.89% | 92.86% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.63% | 96.47% |
| CHEMBL260 | Q16539 | MAP kinase p38 alpha | 89.89% | 97.78% |
| CHEMBL3776 | Q14790 | Caspase-8 | 89.41% | 97.06% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 89.30% | 97.79% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 88.61% | 98.33% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 88.20% | 91.81% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.79% | 96.00% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 86.64% | 90.93% |
| CHEMBL4662 | P28074 | Proteasome Macropain subunit MB1 | 86.03% | 93.85% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.56% | 90.17% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 85.33% | 98.10% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 85.27% | 85.31% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.25% | 100.00% |
| CHEMBL3308 | P55212 | Caspase-6 | 85.03% | 97.56% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 84.65% | 95.00% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.37% | 92.88% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 84.30% | 95.71% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 84.21% | 95.17% |
| CHEMBL268 | P43235 | Cathepsin K | 84.20% | 96.85% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 84.18% | 97.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 83.75% | 96.90% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 83.50% | 92.80% |
| CHEMBL2664 | P23526 | Adenosylhomocysteinase | 83.43% | 86.67% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 83.13% | 93.33% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.08% | 91.19% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 83.03% | 96.67% |
| CHEMBL3238 | P23786 | Carnitine palmitoyltransferase 2 | 82.76% | 94.05% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 82.54% | 95.38% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.89% | 90.71% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.85% | 94.33% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.84% | 97.14% |
| CHEMBL3468 | P55210 | Caspase-7 | 80.86% | 95.68% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.78% | 99.23% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 80.16% | 87.45% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.14% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162973132 |
| LOTUS | LTS0159442 |
| wikiData | Q103818582 |