Ochramide A
| Internal ID | 71ffbc61-ca6c-4417-9672-4707dc23521c |
| Taxonomy | Organoheterocyclic compounds > Diazines > Pyrazines |
| IUPAC Name | 3-[(1R)-1-hydroxy-2-methylpropyl]-6-(2-methylpropyl)-1H-pyrazin-2-one |
| SMILES (Canonical) | CC(C)CC1=CN=C(C(=O)N1)C(C(C)C)O |
| SMILES (Isomeric) | CC(C)CC1=CN=C(C(=O)N1)[C@@H](C(C)C)O |
| InChI | InChI=1S/C12H20N2O2/c1-7(2)5-9-6-13-10(12(16)14-9)11(15)8(3)4/h6-8,11,15H,5H2,1-4H3,(H,14,16)/t11-/m1/s1 |
| InChI Key | HNNUZZMCWXFRQM-LLVKDONJSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.152477885 g/mol |
| Topological Polar Surface Area (TPSA) | 61.70 Ų |
| XlogP | 2.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.54% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.09% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.02% | 96.09% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 92.76% | 89.34% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.46% | 94.75% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.62% | 97.25% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.81% | 98.75% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.42% | 94.73% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.20% | 90.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.52% | 94.45% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 84.08% | 88.56% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.92% | 90.08% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.82% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.82% | 95.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.18% | 90.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.81% | 94.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.25% | 99.17% |
| CHEMBL2424504 | P29375 | Lysine-specific demethylase 5A | 80.23% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146684481 |
| LOTUS | LTS0137205 |
| wikiData | Q105030978 |