O-Demethylabierixin
| Internal ID | 4e1e6c53-49e2-4420-958e-6b305a6d864b |
| Taxonomy | Organic acids and derivatives > Hydroxy acids and derivatives > Medium-chain hydroxy acids and derivatives |
| IUPAC Name | (E,2R,7R)-7-hydroxy-8-[(2S,4R,5R,6R,7R)-7-hydroxy-2-[(2R,5S)-5-[(2R,3S,5R)-5-[(2S,3S,5R,6R)-6-hydroxy-6-(hydroxymethyl)-3,5-dimethyloxan-2-yl]-3-methyloxolan-2-yl]-5-methyloxolan-2-yl]-2,4,6-trimethyl-1,10-dioxaspiro[4.5]decan-9-yl]-2,4-dimethyloct-3-enoic acid |
| SMILES (Canonical) | CC1CC(C(OC1C2CC(C(O2)C3(CCC(O3)C4(CC(C5(O4)C(C(CC(O5)CC(CCC(=CC(C)C(=O)O)C)O)O)C)C)C)C)C)(CO)O)C |
| SMILES (Isomeric) | C[C@H]1C[C@H]([C@@](O[C@@H]1[C@H]2C[C@@H]([C@@H](O2)[C@@]3(CC[C@@H](O3)[C@@]4(C[C@H]([C@@]5(O4)[C@@H]([C@@H](CC(O5)C[C@@H](CC/C(=C/[C@@H](C)C(=O)O)/C)O)O)C)C)C)C)C)(CO)O)C |
| InChI | InChI=1S/C39H66O11/c1-21(14-24(4)35(43)44)10-11-28(41)17-29-18-30(42)27(7)39(47-29)26(6)19-37(9,50-39)32-12-13-36(8,48-32)34-23(3)16-31(46-34)33-22(2)15-25(5)38(45,20-40)49-33/h14,22-34,40-42,45H,10-13,15-20H2,1-9H3,(H,43,44)/b21-14+/t22-,23-,24+,25+,26+,27+,28+,29?,30+,31+,32+,33-,34+,36-,37-,38-,39+/m0/s1 |
| InChI Key | FAXFZTXEUCHSOG-POPRNECSSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C39H66O11 |
| Molecular Weight | 710.90 g/mol |
| Exact Mass | 710.46051292 g/mol |
| Topological Polar Surface Area (TPSA) | 164.00 Ų |
| XlogP | 5.00 |
| Atomic LogP (AlogP) | 4.96 |
| H-Bond Acceptor | 10 |
| H-Bond Donor | 5 |
| Rotatable Bonds | 11 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9052 | 90.52% |
| Caco-2 | - | 0.8734 | 87.34% |
| Blood Brain Barrier | - | 0.7250 | 72.50% |
| Human oral bioavailability | - | 0.7857 | 78.57% |
| Subcellular localzation | Mitochondria | 0.8415 | 84.15% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8634 | 86.34% |
| OATP1B3 inhibitior | + | 0.9279 | 92.79% |
| MATE1 inhibitior | - | 0.9800 | 98.00% |
| OCT2 inhibitior | - | 0.8500 | 85.00% |
| BSEP inhibitior | - | 0.5682 | 56.82% |
| P-glycoprotein inhibitior | + | 0.7832 | 78.32% |
| P-glycoprotein substrate | + | 0.6520 | 65.20% |
| CYP3A4 substrate | + | 0.7252 | 72.52% |
| CYP2C9 substrate | - | 0.6083 | 60.83% |
| CYP2D6 substrate | - | 0.8759 | 87.59% |
| CYP3A4 inhibition | - | 0.8443 | 84.43% |
| CYP2C9 inhibition | - | 0.9194 | 91.94% |
| CYP2C19 inhibition | - | 0.9292 | 92.92% |
| CYP2D6 inhibition | - | 0.9505 | 95.05% |
| CYP1A2 inhibition | - | 0.9206 | 92.06% |
| CYP2C8 inhibition | + | 0.6165 | 61.65% |
| CYP inhibitory promiscuity | - | 0.9620 | 96.20% |
| UGT catelyzed | - | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 1.0000 | 100.00% |
| Carcinogenicity (trinary) | Non-required | 0.5174 | 51.74% |
| Eye corrosion | - | 0.9914 | 99.14% |
| Eye irritation | - | 0.9165 | 91.65% |
| Skin irritation | + | 0.5894 | 58.94% |
| Skin corrosion | - | 0.9439 | 94.39% |
| Ames mutagenesis | - | 0.6300 | 63.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.3869 | 38.69% |
| Micronuclear | - | 0.8500 | 85.00% |
| Hepatotoxicity | - | 0.6318 | 63.18% |
| skin sensitisation | - | 0.9108 | 91.08% |
| Respiratory toxicity | + | 0.6556 | 65.56% |
| Reproductive toxicity | + | 0.8667 | 86.67% |
| Mitochondrial toxicity | + | 0.6250 | 62.50% |
| Nephrotoxicity | - | 0.6636 | 66.36% |
| Acute Oral Toxicity (c) | I | 0.7539 | 75.39% |
| Estrogen receptor binding | + | 0.7157 | 71.57% |
| Androgen receptor binding | + | 0.7483 | 74.83% |
| Thyroid receptor binding | - | 0.5749 | 57.49% |
| Glucocorticoid receptor binding | + | 0.7151 | 71.51% |
| Aromatase binding | + | 0.6890 | 68.90% |
| PPAR gamma | + | 0.7164 | 71.64% |
| Honey bee toxicity | - | 0.7327 | 73.27% |
| Biodegradation | - | 0.7000 | 70.00% |
| Crustacea aquatic toxicity | - | 0.6800 | 68.00% |
| Fish aquatic toxicity | + | 0.9560 | 95.60% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.71% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.54% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.72% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.28% | 98.95% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 93.36% | 94.45% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 92.67% | 97.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.88% | 89.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.52% | 90.17% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.20% | 91.19% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 90.53% | 96.61% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 89.99% | 96.95% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.93% | 95.89% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 89.82% | 95.50% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.62% | 93.56% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.25% | 96.47% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.75% | 91.11% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 88.60% | 89.05% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 88.06% | 89.50% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.52% | 86.33% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 87.33% | 97.64% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 87.24% | 82.50% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.91% | 100.00% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 86.38% | 95.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.27% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.98% | 99.17% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.04% | 97.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.95% | 96.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.70% | 93.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 84.42% | 98.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.37% | 99.23% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.81% | 100.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 83.25% | 93.10% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 83.22% | 96.03% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 83.05% | 96.90% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.76% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.30% | 95.56% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.13% | 82.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139584456 |
| LOTUS | LTS0142034 |
| wikiData | Q77369322 |