Norvisnagin
| Internal ID | 3333eb26-089c-4309-9ea0-da21cb5d042d |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Chromones > Furanochromones |
| IUPAC Name | 4-hydroxy-7-methylfuro[3,2-g]chromen-5-one |
| SMILES (Canonical) | CC1=CC(=O)C2=C(O1)C=C3C(=C2O)C=CO3 |
| SMILES (Isomeric) | CC1=CC(=O)C2=C(O1)C=C3C(=C2O)C=CO3 |
| InChI | InChI=1S/C12H8O4/c1-6-4-8(13)11-10(16-6)5-9-7(12(11)14)2-3-15-9/h2-5,14H,1H3 |
| InChI Key | XNJXARQRJIOYLC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C12H8O4 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.04225873 g/mol |
| Topological Polar Surface Area (TPSA) | 59.70 Ų |
| XlogP | 2.50 |
| 5-Norvisnagin |
| 5H-Furo[3,2-g][1]benzopyran-5-one, 4-hydroxy-7-methyl- |
| 4-hydroxy-7-methylfuro[3,2-g]chromen-5-one |
| SCHEMBL3614195 |
| CHEBI:81362 |
| 4-Hydroxy-7-methyl-furo[3,2-g]chromen-5-one |
| C17843 |
| 4-Hydroxy-7-methyl-5H-furo[3,2-g]chromen-5-one |
| 4-hydroxy-7-methylpyrano[3,2-f][1]benzoxol-5-one |
| 4-Hydroxy-7-methyl-5H-furo[3,2-g]chromen-5-one # |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 99.12% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.63% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.27% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 94.09% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.27% | 95.56% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 92.67% | 93.65% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.54% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.23% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.51% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.58% | 85.14% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.91% | 99.23% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.48% | 90.71% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 82.57% | 94.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Actaea cimicifuga |
| PubChem | 612239 |
| LOTUS | LTS0213776 |
| wikiData | Q27155300 |