Norsacocapnine (+) hydrochloride
| Internal ID | 76eccfc2-fde6-411a-ac48-5d92683a68dc |
| Taxonomy | Alkaloids and derivatives > Cularin alkaloids and derivatives |
| IUPAC Name | 4,5,17-trimethoxy-2-oxa-11-azatetracyclo[8.7.1.03,8.014,18]octadeca-1(17),3(8),4,6,14(18),15-hexaene |
| SMILES (Canonical) | COC1=C2C3=C(CCNC3CC4=C(O2)C(=C(C=C4)OC)OC)C=C1 |
| SMILES (Isomeric) | COC1=C2C3=C(CCNC3CC4=C(O2)C(=C(C=C4)OC)OC)C=C1 |
| InChI | InChI=1S/C19H21NO4/c1-21-14-6-4-11-8-9-20-13-10-12-5-7-15(22-2)19(23-3)17(12)24-18(14)16(11)13/h4-7,13,20H,8-10H2,1-3H3 |
| InChI Key | RDCPENDAKRKOTO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.14705815 g/mol |
| Topological Polar Surface Area (TPSA) | 49.00 Ų |
| XlogP | 2.80 |
| NSC638721 |
| 6,8,9-Trimethoxy-2,3,12,12a-tetrahydro-1H-[1]benzoxepino[2,3,4-ij]isoquinoline hydrochloride |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.99% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 93.73% | 83.82% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.32% | 97.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.09% | 93.99% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.43% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.96% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.36% | 95.89% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.56% | 92.94% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.52% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.07% | 94.45% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 82.22% | 96.76% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.00% | 99.17% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.75% | 94.75% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.45% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ceratocapnos claviculata |
| Ceratocapnos heterocarpa |
| PubChem | 368266 |
| LOTUS | LTS0112733 |
| wikiData | Q104375921 |