Norpreocoteine
| Internal ID | 30564afa-574d-4b2d-88d9-5c740daf04f3 |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | (6aS)-2,3,9,10-tetramethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol |
| SMILES (Canonical) | COC1=C(C=C2C(=C1)CC3C4=C(CCN3)C(=C(C(=C24)O)OC)OC)OC |
| SMILES (Isomeric) | COC1=C(C=C2C(=C1)C[C@H]3C4=C(CCN3)C(=C(C(=C24)O)OC)OC)OC |
| InChI | InChI=1S/C20H23NO5/c1-23-14-8-10-7-13-16-11(5-6-21-13)19(25-3)20(26-4)18(22)17(16)12(10)9-15(14)24-2/h8-9,13,21-22H,5-7H2,1-4H3/t13-/m0/s1 |
| InChI Key | QIWWOPQLJARYLV-ZDUSSCGKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.15762283 g/mol |
| Topological Polar Surface Area (TPSA) | 69.20 Ų |
| XlogP | 2.50 |
| Norpreocoteine |
| N-Demethylpreocoteine |
| DTXSID101008804 |
| 2,3,9,10-Tetramethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.81% | 91.11% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 95.82% | 92.94% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.45% | 96.09% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 94.63% | 91.79% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.12% | 91.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.00% | 86.33% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 90.90% | 92.68% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.83% | 93.99% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.71% | 97.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.60% | 90.00% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 89.41% | 95.62% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 88.51% | 95.70% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 88.48% | 91.00% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 88.14% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.91% | 95.89% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.85% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.77% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.71% | 98.75% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 86.17% | 88.48% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.65% | 96.21% |
| CHEMBL4355 | O14976 | Serine/threonine-protein kinase GAK | 84.53% | 89.32% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 82.95% | 95.64% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.41% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.16% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.86% | 95.56% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 81.12% | 98.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ocotea mollicella |
| PubChem | 177208 |
| LOTUS | LTS0055307 |
| wikiData | Q83005397 |