Norcapsaicin
Internal ID | 6a967392-c482-44da-a5cc-75d322b99a5d |
Taxonomy | Benzenoids > Phenols > Methoxyphenols |
IUPAC Name | (E)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-7-methyloct-5-enamide |
SMILES (Canonical) | CC(C)C=CCCCC(=O)NCC1=CC(=C(C=C1)O)OC |
SMILES (Isomeric) | CC(C)/C=C/CCCC(=O)NCC1=CC(=C(C=C1)O)OC |
InChI | InChI=1S/C17H25NO3/c1-13(2)7-5-4-6-8-17(20)18-12-14-9-10-15(19)16(11-14)21-3/h5,7,9-11,13,19H,4,6,8,12H2,1-3H3,(H,18,20)/b7-5+ |
InChI Key | UTNZMGHHFHHIAY-FNORWQNLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H25NO3 |
Molecular Weight | 291.40 g/mol |
Exact Mass | 291.18344366 g/mol |
Topological Polar Surface Area (TPSA) | 58.60 Ų |
XlogP | 3.00 |
61229-08-1 |
(E)-N-(4-Hydroxy-3-methoxybenzyl)-7-methyloct-5-enamide |
(E)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-7-methyloct-5-enamide |
SCHEMBL8163896 |
CHEBI:174089 |
7-Methyl-N-vanillyl-5-octenamide |
DTXSID901317984 |
N-[(4-Hydroxy-3-methoxyphenyl)methyl]-7-methyl-5-octenamide, 9CI |
(5E)-N-[(4-HYDROXY-3-METHOXYPHENYL)METHYL]-7-METHYLOCT-5-ENAMIDE |
5-Octenamide, N-((4-hydroxy-3-methoxyphenyl)methyl)-7-methyl-, (E)- |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.56% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.60% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 98.34% | 98.95% |
CHEMBL2535 | P11166 | Glucose transporter | 97.01% | 98.75% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.54% | 96.09% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 94.66% | 90.20% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.56% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.69% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.46% | 90.71% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 88.59% | 90.24% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.49% | 95.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.02% | 96.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.43% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.72% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.70% | 90.00% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 83.28% | 92.88% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 82.85% | 97.29% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 82.24% | 98.11% |
CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 81.22% | 96.67% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.78% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.58% | 91.19% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.02% | 97.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Capsicum annuum |
PubChem | 6442577 |
LOTUS | LTS0221464 |
wikiData | Q76386886 |