nonanoyl-DL-Dab-DL-xiThr-DL-Dab-DL-Dab(1)-DL-Dab-DL-Phe-DL-Leu-DL-Dab-DL-Dab-DL-xiThr-(1)
| Internal ID | c51ecd04-1a27-4715-8507-d97e13b29286 |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | N-[4-amino-1-[[1-[[4-amino-1-oxo-1-[[6,9,18-tris(2-aminoethyl)-15-benzyl-3-(1-hydroxyethyl)-12-(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptazacyclotricos-21-yl]amino]butan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]nonanamide |
| SMILES (Canonical) | CCCCCCCCC(=O)NC(CCN)C(=O)NC(C(C)O)C(=O)NC(CCN)C(=O)NC1CCNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC1=O)CCN)CC2=CC=CC=C2)CC(C)C)CCN)CCN)C(C)O |
| SMILES (Isomeric) | CCCCCCCCC(=O)NC(CCN)C(=O)NC(C(C)O)C(=O)NC(CCN)C(=O)NC1CCNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC1=O)CCN)CC2=CC=CC=C2)CC(C)C)CCN)CCN)C(C)O |
| InChI | InChI=1S/C56H98N16O13/c1-6-7-8-9-10-14-17-44(75)63-36(18-24-57)51(80)72-46(34(5)74)56(85)68-39(21-27-60)48(77)67-41-23-29-62-55(84)45(33(4)73)71-52(81)40(22-28-61)65-47(76)37(19-25-58)66-53(82)42(30-32(2)3)69-54(83)43(31-35-15-12-11-13-16-35)70-49(78)38(20-26-59)64-50(41)79/h11-13,15-16,32-34,36-43,45-46,73-74H,6-10,14,17-31,57-61H2,1-5H3,(H,62,84)(H,63,75)(H,64,79)(H,65,76)(H,66,82)(H,67,77)(H,68,85)(H,69,83)(H,70,78)(H,71,81)(H,72,80) |
| InChI Key | RGUCBEFVOXUBFX-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C56H98N16O13 |
| Molecular Weight | 1203.50 g/mol |
| Exact Mass | 1202.74992724 g/mol |
| Topological Polar Surface Area (TPSA) | 491.00 Ų |
| XlogP | -2.20 |
| Atomic LogP (AlogP) | -5.10 |
| H-Bond Acceptor | 18 |
| H-Bond Donor | 18 |
| Rotatable Bonds | 30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8054 | 80.54% |
| Caco-2 | - | 0.8638 | 86.38% |
| Blood Brain Barrier | - | 0.7500 | 75.00% |
| Human oral bioavailability | - | 0.8000 | 80.00% |
| Subcellular localzation | Mitochondria | 0.5618 | 56.18% |
| OATP2B1 inhibitior | - | 0.8582 | 85.82% |
| OATP1B1 inhibitior | + | 0.9190 | 91.90% |
| OATP1B3 inhibitior | + | 0.9114 | 91.14% |
| MATE1 inhibitior | - | 0.9200 | 92.00% |
| OCT2 inhibitior | - | 0.9750 | 97.50% |
| BSEP inhibitior | + | 0.9589 | 95.89% |
| P-glycoprotein inhibitior | + | 0.7417 | 74.17% |
| P-glycoprotein substrate | + | 0.8915 | 89.15% |
| CYP3A4 substrate | + | 0.6949 | 69.49% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.7325 | 73.25% |
| CYP3A4 inhibition | - | 0.6778 | 67.78% |
| CYP2C9 inhibition | - | 0.9365 | 93.65% |
| CYP2C19 inhibition | - | 0.9012 | 90.12% |
| CYP2D6 inhibition | - | 0.9187 | 91.87% |
| CYP1A2 inhibition | - | 0.9159 | 91.59% |
| CYP2C8 inhibition | + | 0.6374 | 63.74% |
| CYP inhibitory promiscuity | - | 0.9869 | 98.69% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.8300 | 83.00% |
| Carcinogenicity (trinary) | Non-required | 0.6608 | 66.08% |
| Eye corrosion | - | 0.9874 | 98.74% |
| Eye irritation | - | 0.8967 | 89.67% |
| Skin irritation | - | 0.7759 | 77.59% |
| Skin corrosion | - | 0.9275 | 92.75% |
| Ames mutagenesis | - | 0.7700 | 77.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7038 | 70.38% |
| Micronuclear | + | 0.7500 | 75.00% |
| Hepatotoxicity | - | 0.8218 | 82.18% |
| skin sensitisation | - | 0.8799 | 87.99% |
| Respiratory toxicity | + | 0.8444 | 84.44% |
| Reproductive toxicity | + | 0.9000 | 90.00% |
| Mitochondrial toxicity | + | 0.8000 | 80.00% |
| Nephrotoxicity | + | 0.8217 | 82.17% |
| Acute Oral Toxicity (c) | III | 0.7557 | 75.57% |
| Estrogen receptor binding | + | 0.7324 | 73.24% |
| Androgen receptor binding | + | 0.6498 | 64.98% |
| Thyroid receptor binding | - | 0.7369 | 73.69% |
| Glucocorticoid receptor binding | + | 0.6012 | 60.12% |
| Aromatase binding | + | 0.7040 | 70.40% |
| PPAR gamma | + | 0.7475 | 74.75% |
| Honey bee toxicity | - | 0.8246 | 82.46% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | + | 0.6500 | 65.00% |
| Fish aquatic toxicity | + | 0.6549 | 65.49% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.94% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.96% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.52% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.85% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.98% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.64% | 94.45% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.33% | 90.17% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 95.33% | 97.64% |
| CHEMBL3837 | P07711 | Cathepsin L | 95.01% | 96.61% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 94.86% | 94.45% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 94.49% | 88.42% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 94.05% | 98.33% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 93.36% | 96.47% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 93.36% | 97.14% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 92.75% | 97.23% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 91.78% | 95.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 90.79% | 93.03% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.34% | 90.71% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.27% | 93.56% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 89.10% | 92.97% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.75% | 95.89% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.44% | 93.00% |
| CHEMBL1293287 | P14735 | Insulin-degrading enzyme | 88.04% | 88.10% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 86.85% | 98.05% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 86.31% | 98.24% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 85.90% | 92.88% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 85.85% | 82.38% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.48% | 95.56% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 85.22% | 92.08% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.57% | 100.00% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 84.32% | 93.18% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.22% | 97.29% |
| CHEMBL4071 | P08311 | Cathepsin G | 83.07% | 94.64% |
| CHEMBL2327 | P21452 | Neurokinin 2 receptor | 82.81% | 98.89% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.52% | 96.90% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 82.08% | 96.11% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 81.31% | 95.93% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 81.28% | 94.55% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 81.19% | 100.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 80.83% | 90.20% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.47% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73015506 |
| LOTUS | LTS0109204 |
| wikiData | Q77492775 |