Nocardione B
| Internal ID | 383e1ac5-6954-4185-a7f9-dafe7861c89e |
| Taxonomy | Organoheterocyclic compounds > Naphthofurans |
| IUPAC Name | 6-methoxy-2-methyl-2,3-dihydrobenzo[g][1]benzofuran-4,5-dione |
| SMILES (Canonical) | CC1CC2=C(O1)C3=C(C(=CC=C3)OC)C(=O)C2=O |
| SMILES (Isomeric) | CC1CC2=C(O1)C3=C(C(=CC=C3)OC)C(=O)C2=O |
| InChI | InChI=1S/C14H12O4/c1-7-6-9-12(15)13(16)11-8(14(9)18-7)4-3-5-10(11)17-2/h3-5,7H,6H2,1-2H3 |
| InChI Key | VIEJGPLASHRUTP-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.07355886 g/mol |
| Topological Polar Surface Area (TPSA) | 52.60 Ų |
| XlogP | 1.60 |
| VIEJGPLASHRUTP-UHFFFAOYSA- |
| 6-methoxy-2-methyl-2,3-dihydrobenzo[g][1]benzofuran-4,5-dione |
| InChI=1/C14H12O4/c1-7-6-9-12(15)13(16)11-8(14(9)18-7)4-3-5-10(11)17-2/h3-5,7H,6H2,1-2H3 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.46% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.42% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.45% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.06% | 96.09% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 90.05% | 94.03% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.56% | 99.23% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.14% | 97.14% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 85.94% | 96.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.79% | 98.75% |
| CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 85.53% | 96.86% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.92% | 94.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 83.30% | 93.31% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.98% | 89.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.62% | 95.89% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.54% | 96.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.53% | 93.03% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.43% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cryptomeria japonica |
| Halocarpus bidwillii |
| Lepidothamnus intermedius |
| PubChem | 10243534 |
| LOTUS | LTS0258310 |
| wikiData | Q105147772 |