Nocardamin glucuronide
| Internal ID | 6ffc3c21-ecce-42fb-8e7c-7665dbdf8ddd |
| Taxonomy | Phenylpropanoids and polyketides > Macrolactams |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-[(12,23-dihydroxy-2,5,13,16,24,27-hexaoxo-1,6,12,17,23,28-hexazacyclotritriacont-1-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES (Canonical) | C1CCNC(=O)CCC(=O)N(CCCCCNC(=O)CCC(=O)N(CCCCCNC(=O)CCC(=O)N(CC1)O)OC2C(C(C(C(O2)C(=O)O)O)O)O)O |
| SMILES (Isomeric) | C1CCNC(=O)CCC(=O)N(CCCCCNC(=O)CCC(=O)N(CCCCCNC(=O)CCC(=O)N(CC1)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O)O |
| InChI | InChI=1S/C33H56N6O15/c40-22-10-13-25(43)38(52)20-8-2-5-17-36-24(42)12-15-27(45)39(54-33-30(48)28(46)29(47)31(53-33)32(49)50)21-9-3-6-18-35-23(41)11-14-26(44)37(51)19-7-1-4-16-34-22/h28-31,33,46-48,51-52H,1-21H2,(H,34,40)(H,35,41)(H,36,42)(H,49,50)/t28-,29-,30+,31-,33-/m0/s1 |
| InChI Key | BXAKDNZHCXUJKG-MOZJAVLYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C33H56N6O15 |
| Molecular Weight | 776.80 g/mol |
| Exact Mass | 776.38036510 g/mol |
| Topological Polar Surface Area (TPSA) | 305.00 Ų |
| XlogP | -3.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 93.55% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.04% | 96.09% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 90.39% | 93.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.94% | 85.14% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.04% | 83.82% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.25% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.01% | 99.23% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.32% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.16% | 91.11% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.02% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.83% | 89.00% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 81.76% | 83.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.31% | 86.33% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.46% | 90.24% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.44% | 90.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.42% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 145720720 |
| LOTUS | LTS0071234 |
| wikiData | Q104947836 |