Nocarbenzoxazole G
| Internal ID | e79c1aa2-a068-4fbf-bfd8-0edc2975c9f5 |
| Taxonomy | Organoheterocyclic compounds > Azoles > Oxazoles > Phenyl-1,3-oxazoles |
| IUPAC Name | 4-[5-(hydroxymethyl)-1,3-benzoxazol-2-yl]-3-methoxyphenol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H13NO4/c1-19-14-7-10(18)3-4-11(14)15-16-12-6-9(8-17)2-5-13(12)20-15/h2-7,17-18H,8H2,1H3 |
| InChI Key | FMKKXSLFSSVDCS-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08445790 g/mol |
| Topological Polar Surface Area (TPSA) | 75.70 Ų |
| XlogP | 2.20 |
| CHEMBL3601936 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.53% | 94.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.17% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.12% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.15% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.09% | 86.33% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 90.79% | 90.20% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.59% | 91.11% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 90.45% | 95.12% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 89.92% | 93.10% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.70% | 85.14% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 86.53% | 91.49% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 86.49% | 85.49% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 86.00% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.59% | 98.75% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.54% | 90.24% |
| CHEMBL3706 | P78536 | ADAM17 | 81.72% | 90.71% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 80.74% | 97.53% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.57% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 137133304 |
| LOTUS | LTS0073216 |
| wikiData | Q77493406 |