Nobiline, 6-hydroxy-
| Internal ID | 9bfb2436-b7b3-4731-808a-c29c16033a31 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
| IUPAC Name | 5-[(dimethylamino)methyl]-2-hydroxy-6-methyl-11-propan-2-yl-9-oxatricyclo[6.2.1.02,6]undecane-7,10-dione |
| SMILES (Canonical) | CC(C)C1C2C(=O)OC1C(=O)C3(C2(CCC3CN(C)C)O)C |
| SMILES (Isomeric) | CC(C)C1C2C(=O)OC1C(=O)C3(C2(CCC3CN(C)C)O)C |
| InChI | InChI=1S/C17H27NO4/c1-9(2)11-12-15(20)22-13(11)14(19)16(3)10(8-18(4)5)6-7-17(12,16)21/h9-13,21H,6-8H2,1-5H3 |
| InChI Key | VIYATZGHULRBIO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.19400834 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 1.40 |
| 6-Hydroxynobiline |
| VIYATZGHULRBIO-UHFFFAOYSA-N |
| 1,4-Methano-2H-cyclopent[d]oxepin-2,5(4H)-dione, 6-[(dimethylamino)methyl]hexahydro-8a-hydroxy-5a-methyl-9-(1-methylethyl)-, [1R-(1.alpha.,4.alpha.,5a.alpha.,6.beta.,8a.alpha.,9S*)]- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.50% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.32% | 96.09% |
| CHEMBL204 | P00734 | Thrombin | 91.58% | 96.01% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.06% | 91.11% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.09% | 94.75% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 90.04% | 90.08% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.70% | 85.14% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.15% | 97.25% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 85.49% | 97.79% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.69% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.13% | 95.56% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.98% | 97.14% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.30% | 100.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.14% | 100.00% |
| CHEMBL3837 | P07711 | Cathepsin L | 80.88% | 96.61% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.87% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dendrobium moniliforme |
| PubChem | 547118 |
| LOTUS | LTS0078564 |
| wikiData | Q105287089 |