Nitraminoacetic acid
| Internal ID | 8a317cf3-6ba1-4ef9-ac32-e78af11ba649 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives |
| IUPAC Name | 2-nitramidoacetic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C2H4N2O4/c5-2(6)1-3-4(7)8/h3H,1H2,(H,5,6) |
| InChI Key | MJHPFRRMGOFOJL-UHFFFAOYSA-N |
| Popularity | 8 references in papers |
| Molecular Formula | C2H4N2O4 |
| Molecular Weight | 120.06 g/mol |
| Exact Mass | 120.01710661 g/mol |
| Topological Polar Surface Area (TPSA) | 95.20 Ų |
| XlogP | 0.10 |
| 2-(nitroamino)acetic acid |
| 10339-31-8 |
| 2-nitramidoacetic acid |
| N-Nitroglycine |
| N-Nitroglicin |
| GLYCINE, N-NITRO- |
| BRN 1812131 |
| Nitroglycin |
| Nitraminoacetate |
| SCHEMBL4375056 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.84% | 90.17% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.49% | 83.82% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.46% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.96% | 98.95% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 83.26% | 90.20% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.87% | 91.19% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.29% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 25184 |
| LOTUS | LTS0068177 |
| wikiData | Q83010456 |