nicotianoside II
Internal ID | 0ed4688e-158c-4629-8004-cfb2ffe9eb05 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Diterpene glycosides |
IUPAC Name | 3-[[(2R,3S,4S,5R,6R)-6-[(2Z,6E,10E,14S)-14-[(2S,3R,4R,5S,6R)-6-[(2-carboxyacetyl)oxymethyl]-3,4-dihydroxy-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-2,6,10,14-tetramethylhexadeca-2,6,10,15-tetraenoxy]-3,4,5-trihydroxyoxan-2-yl]methoxy]-3-oxopropanoic acid |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC(C)(CCC=C(C)CCC=C(C)CCC=C(C)COC3C(C(C(C(O3)COC(=O)CC(=O)O)O)O)O)C=C)COC(=O)CC(=O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)O)O[C@@](C)(CC/C=C(\C)/CC/C=C(\C)/CC/C=C(/C)\CO[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)COC(=O)CC(=O)O)O)O)O)C=C)COC(=O)CC(=O)O)O)O)O |
InChI | InChI=1S/C44H68O22/c1-7-44(6,66-43-39(58)36(55)40(27(64-43)21-60-31(50)18-29(47)48)65-42-38(57)34(53)32(51)25(5)62-42)16-10-15-23(3)12-8-11-22(2)13-9-14-24(4)19-61-41-37(56)35(54)33(52)26(63-41)20-59-30(49)17-28(45)46/h7,11,14-15,25-27,32-43,51-58H,1,8-10,12-13,16-21H2,2-6H3,(H,45,46)(H,47,48)/b22-11+,23-15+,24-14-/t25-,26+,27+,32-,33+,34+,35-,36+,37+,38+,39+,40+,41+,42-,43-,44+/m0/s1 |
InChI Key | ZKXDFLSRCGZCSL-AVKJSAJJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C44H68O22 |
Molecular Weight | 949.00 g/mol |
Exact Mass | 948.42022379 g/mol |
Topological Polar Surface Area (TPSA) | 344.00 Ų |
XlogP | 0.30 |
(3S,6E,10E,14Z)-16-{[6-O-(carboxyacetyl)-beta-D-glucopyranosyl]oxy}-3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraen-3-yl 6-O-(carboxyacetyl)-4-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranoside |
CHEBI:67243 |
Q27135714 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.21% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.87% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.71% | 96.09% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 92.32% | 97.36% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.17% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 90.06% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.79% | 86.33% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.66% | 96.61% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.16% | 96.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.45% | 96.47% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.35% | 92.50% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.18% | 91.19% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.09% | 94.33% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 84.90% | 95.71% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.43% | 96.90% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.98% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.59% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Nicotiana attenuata |
PubChem | 71296133 |
LOTUS | LTS0204268 |
wikiData | Q27135714 |