Nicotelline
| Internal ID | f45f174c-4831-4429-a5c5-547e4287fc97 |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Bipyridines and oligopyridines |
| IUPAC Name | 2,4-dipyridin-3-ylpyridine |
| SMILES (Canonical) | C1=CC(=CN=C1)C2=CC(=NC=C2)C3=CN=CC=C3 |
| SMILES (Isomeric) | C1=CC(=CN=C1)C2=CC(=NC=C2)C3=CN=CC=C3 |
| InChI | InChI=1S/C15H11N3/c1-3-13(10-16-6-1)12-5-8-18-15(9-12)14-4-2-7-17-11-14/h1-11H |
| InChI Key | OILSPHJMIPYURT-UHFFFAOYSA-N |
| Popularity | 51 references in papers |
| Molecular Formula | C15H11N3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.095297364 g/mol |
| Topological Polar Surface Area (TPSA) | 38.70 Ų |
| XlogP | 2.00 |
| 494-04-2 |
| Nicotellin |
| 3,2':4',3''-Terpyridine |
| 2,4-dipyridin-3-ylpyridine |
| 7AO144V8IZ |
| UNII-7AO144V8IZ |
| NICOTELLINE [MI] |
| SCHEMBL1760672 |
| 4-N-NONYLBENZOYLCHLORIDE |
| 2,4-Di(pyridin-3-yl)pyridine |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 94.21% | 97.53% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.25% | 91.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.00% | 86.33% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 89.13% | 81.11% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 85.06% | 93.65% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.06% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.65% | 94.73% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 83.49% | 96.00% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 82.78% | 96.47% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.29% | 97.36% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.24% | 93.10% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.07% | 94.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.55% | 100.00% |
| CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 80.87% | 95.71% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.85% | 96.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.58% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.53% | 98.75% |
| CHEMBL275 | Q07343 | Phosphodiesterase 4B | 80.52% | 98.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Nicotiana tabacum |
| PubChem | 68123 |
| LOTUS | LTS0113740 |
| wikiData | Q27266849 |