Nicardipine
Internal ID | f9542499-6266-4629-8a9d-c9679fe759be |
Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Hydropyridines > Dihydropyridines > Dihydropyridinecarboxylic acids and derivatives |
IUPAC Name | 5-O-[2-[benzyl(methyl)amino]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
SMILES (Canonical) | CC1=C(C(C(=C(N1)C)C(=O)OCCN(C)CC2=CC=CC=C2)C3=CC(=CC=C3)[N+](=O)[O-])C(=O)OC |
SMILES (Isomeric) | CC1=C(C(C(=C(N1)C)C(=O)OCCN(C)CC2=CC=CC=C2)C3=CC(=CC=C3)[N+](=O)[O-])C(=O)OC |
InChI | InChI=1S/C26H29N3O6/c1-17-22(25(30)34-4)24(20-11-8-12-21(15-20)29(32)33)23(18(2)27-17)26(31)35-14-13-28(3)16-19-9-6-5-7-10-19/h5-12,15,24,27H,13-14,16H2,1-4H3 |
InChI Key | ZBBHBTPTTSWHBA-UHFFFAOYSA-N |
Popularity | 7,051 references in papers |
Molecular Formula | C26H29N3O6 |
Molecular Weight | 479.50 g/mol |
Exact Mass | 479.20563565 g/mol |
Topological Polar Surface Area (TPSA) | 114.00 Ų |
XlogP | 3.80 |
Atomic LogP (AlogP) | 3.68 |
H-Bond Acceptor | 8 |
H-Bond Donor | 1 |
Rotatable Bonds | 9 |
55985-32-5 |
Nicardipinum |
Nicardipinum [INN-Latin] |
Nicardipino [INN-Spanish] |
Nicardipino |
Perpidine |
Nicardipine [INN:BAN] |
Cardene |
Nicardipine LA |
Nicardipine (stn) |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.8814 | 88.14% |
Caco-2 | - | 0.6122 | 61.22% |
Blood Brain Barrier | - | 0.9000 | 90.00% |
Human oral bioavailability | - | 0.5429 | 54.29% |
Subcellular localzation | Mitochondria | 0.7203 | 72.03% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9002 | 90.02% |
OATP1B3 inhibitior | + | 0.8561 | 85.61% |
MATE1 inhibitior | - | 0.8800 | 88.00% |
OCT2 inhibitior | + | 0.7500 | 75.00% |
BSEP inhibitior | + | 0.9941 | 99.41% |
P-glycoprotein inhibitior | + | 0.9305 | 93.05% |
P-glycoprotein substrate | + | 0.7307 | 73.07% |
CYP3A4 substrate | + | 0.7865 | 78.65% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8822 | 88.22% |
CYP3A4 inhibition | + | 0.7959 | 79.59% |
CYP2C9 inhibition | + | 0.8948 | 89.48% |
CYP2C19 inhibition | + | 0.8994 | 89.94% |
CYP2D6 inhibition | + | 0.8932 | 89.32% |
CYP1A2 inhibition | + | 0.9107 | 91.07% |
CYP2C8 inhibition | + | 0.9817 | 98.17% |
CYP inhibitory promiscuity | + | 0.8558 | 85.58% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.7200 | 72.00% |
Carcinogenicity (trinary) | Non-required | 0.5167 | 51.67% |
Eye corrosion | - | 0.9886 | 98.86% |
Eye irritation | - | 0.9699 | 96.99% |
Skin irritation | - | 0.7969 | 79.69% |
Skin corrosion | - | 0.9363 | 93.63% |
Ames mutagenesis | - | 0.8400 | 84.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.7259 | 72.59% |
Micronuclear | + | 0.8900 | 89.00% |
Hepatotoxicity | - | 0.7750 | 77.50% |
skin sensitisation | - | 0.8476 | 84.76% |
Respiratory toxicity | + | 0.9556 | 95.56% |
Reproductive toxicity | + | 0.8000 | 80.00% |
Mitochondrial toxicity | + | 1.0000 | 100.00% |
Nephrotoxicity | - | 0.9398 | 93.98% |
Acute Oral Toxicity (c) | II | 0.4326 | 43.26% |
Estrogen receptor binding | + | 0.6474 | 64.74% |
Androgen receptor binding | + | 0.8165 | 81.65% |
Thyroid receptor binding | + | 0.6533 | 65.33% |
Glucocorticoid receptor binding | + | 0.8198 | 81.98% |
Aromatase binding | - | 0.5000 | 50.00% |
PPAR gamma | + | 0.8185 | 81.85% |
Honey bee toxicity | - | 0.8671 | 86.71% |
Biodegradation | - | 0.9000 | 90.00% |
Crustacea aquatic toxicity | - | 0.7200 | 72.00% |
Fish aquatic toxicity | + | 0.9852 | 98.52% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL256 | P0DMS8 | Adenosine A3 receptor |
3250 nM |
Ki |
PMID: 8709132
|
CHEMBL5393 | Q9UNQ0 | ATP-binding cassette sub-family G member 2 |
16595.87 nM |
IC50 |
PMID: 18678495
|
CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
13300 nM |
IC50 |
PMID: 23033255
|
CHEMBL3622 | P33261 | Cytochrome P450 2C19 |
560 nM 3300 nM |
IC50 IC50 |
PMID: 23033255
PMID: 22328583 |
CHEMBL3721 | P10632 | Cytochrome P450 2C8 |
1560 nM |
IC50 |
PMID: 22328583
|
CHEMBL3397 | P11712 | Cytochrome P450 2C9 |
660 nM 378 nM |
IC50 IC50 |
PMID: 23033255
PMID: 22328583 |
CHEMBL289 | P10635 | Cytochrome P450 2D6 |
1780 nM 1590 nM |
IC50 IC50 |
PMID: 23033255
PMID: 22328583 |
CHEMBL3491 | P51589 | Cytochrome P450 2J2 |
1690 nM |
IC50 |
PMID: 23033255
|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
380 nM 420 nM |
IC50 IC50 |
PMID: 23033255
PMID: 12699389 |
CHEMBL4040 | P28482 | MAP kinase ERK2 |
12.6 nM |
Potency |
via Super-PRED
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
8912.5 nM 19952.6 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL4302 | P08183 | P-glycoprotein 1 |
3200 nM 5600 nM 6600 nM 7100 nM 4540 nM 950 nM 2300 nM 2300 nM 5128.61 nM 4786.3 nM 4786.3 nM |
IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 |
PMID: 11716514
PMID: 11716514 PMID: 11716514 PMID: 11716514 PMID: 12128170 PMID: 12699389 PMID: 12699389 PMID: 12699389 PMID: 17890094 PMID: 17890094 PMID: 18678495 |
CHEMBL1293235 | P02545 | Prelamin-A/C |
1995.3 nM |
Potency |
via CMAUP
|
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR |
26121.6 nM 18492.7 nM 18492.7 nM 23280.9 nM |
Potency Potency Potency Potency |
via CMAUP
via CMAUP via CMAUP via CMAUP |
CHEMBL1293232 | Q16637 | Survival motor neuron protein |
35481.3 nM |
Potency |
via CMAUP
|
CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
56234.1 nM 44668.4 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1940 | Q13936 | Voltage-gated L-type calcium channel alpha-1C subunit |
250 nM 24100 nM 9600 nM 250 nM |
IC50 IC50 IC50 IC50 |
PMID: 22761000
PMID: 22761000 PMID: 22761000 via Super-PRED |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.14% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.57% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 96.75% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 94.57% | 94.73% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.40% | 90.17% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.13% | 99.17% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 91.57% | 90.20% |
CHEMBL5028 | O14672 | ADAM10 | 88.69% | 97.50% |
CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 88.55% | 93.81% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.12% | 97.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.40% | 96.95% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 86.19% | 89.67% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.86% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.84% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.83% | 95.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.88% | 95.89% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.51% | 93.03% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.92% | 91.19% |
CHEMBL3231 | Q13464 | Rho-associated protein kinase 1 | 81.68% | 95.55% |
CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 81.35% | 95.48% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.45% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cinnamomum aromaticum |
PubChem | 4474 |
NPASS | NPC36836 |
ChEMBL | CHEMBL1484 |