NF 00659A(sub 1)
| Internal ID | 35e7bbb8-6c50-4de9-b783-89ef4c3c309b |
| Taxonomy | Organoheterocyclic compounds > Oxepanes |
| IUPAC Name | [10-hydroxy-8-[(4-hydroxy-5,6-dimethyl-2-oxopyran-3-yl)methyl]-4,4,7a,11b-tetramethyl-9-methylidene-1,2,3,5a,6,7,8,10,11,11a-decahydronaphtho[2,1-b]oxepin-3-yl] (2E,4E)-6-methylocta-2,4-dienoate |
| SMILES (Canonical) | CCC(C)C=CC=CC(=O)OC1CCC2(C(CCC3(C2CC(C(=C)C3CC4=C(C(=C(OC4=O)C)C)O)O)C)OC1(C)C)C |
| SMILES (Isomeric) | CCC(C)/C=C/C=C/C(=O)OC1CCC2(C(CCC3(C2CC(C(=C)C3CC4=C(C(=C(OC4=O)C)C)O)O)C)OC1(C)C)C |
| InChI | InChI=1S/C36H52O7/c1-10-21(2)13-11-12-14-31(38)42-29-15-18-36(9)28-20-27(37)23(4)26(19-25-32(39)22(3)24(5)41-33(25)40)35(28,8)17-16-30(36)43-34(29,6)7/h11-14,21,26-30,37,39H,4,10,15-20H2,1-3,5-9H3/b13-11+,14-12+ |
| InChI Key | GLJUDWCQRLSFDX-PHEQNACWSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C36H52O7 |
| Molecular Weight | 596.80 g/mol |
| Exact Mass | 596.37130399 g/mol |
| Topological Polar Surface Area (TPSA) | 102.00 Ų |
| XlogP | 6.30 |
| (10-hydroxy-8-((4-hydroxy-5,6-dimethyl-2-oxopyran-3-yl)methyl)-4,4,7a,11b-tetramethyl-9-methylidene-1,2,3,5a,6,7,8,10,11,11a-decahydronaphtho(2,1-b)oxepin-3-yl) (2E,4E)-6-methylocta-2,4-dienoate |
| [10-hydroxy-8-[(4-hydroxy-5,6-dimethyl-2-oxopyran-3-yl)methyl]-4,4,7a,11b-tetramethyl-9-methylidene-1,2,3,5a,6,7,8,10,11,11a-decahydronaphtho[2,1-b]oxepin-3-yl] (2E,4E)-6-methylocta-2,4-dienoate |
| RefChem:1092345 |
| NF 00659A(sub 1) |
| Antibiotic NF00659A(sub 1) |
| 169107-90-8 |
| CHEBI:198749 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.70% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.94% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.36% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.32% | 98.95% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 93.51% | 89.63% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.76% | 95.56% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 90.95% | 96.61% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.93% | 94.75% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.41% | 97.09% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.13% | 96.95% |
| CHEMBL204 | P00734 | Thrombin | 88.57% | 96.01% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.38% | 93.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.20% | 96.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.73% | 91.19% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.66% | 95.89% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 84.60% | 89.34% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 84.11% | 97.28% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.31% | 100.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.88% | 98.75% |
| CHEMBL1871 | P10275 | Androgen Receptor | 82.38% | 96.43% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.15% | 94.73% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.03% | 90.17% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.62% | 94.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.51% | 96.90% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 80.90% | 97.79% |
| CHEMBL1977 | P11473 | Vitamin D receptor | 80.44% | 99.43% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.18% | 96.21% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.04% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 54676857 |
| LOTUS | LTS0012633 |
| wikiData | Q75063022 |