Neuroprotectin A
| Internal ID | 3f0f67ae-8e0d-4351-8002-1ff7b1682b96 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | (2R)-2-[[(17R,20R,23R,26R,29S)-20,26-bis(3,5-dichloro-4-hydroxyphenyl)-17-[[2-(3,5-dichloro-4-hydroxyphenyl)-2-oxoacetyl]amino]-37-hydroxy-28-methyl-14,18,21,24,27-pentaoxo-2-oxa-13,19,22,25,28-pentazahexacyclo[29.2.2.13,7.18,12.05,23.011,15]heptatriaconta-1(33),3,5,7(37),8(36),9,11,31,34-nonaene-29-carbonyl]amino]-2-(4-hydroxyphenyl)acetic acid |
| SMILES (Canonical) | CN1C(CC2=CC=C(C=C2)OC3=CC4=CC(=C3O)C5=CC6=C(C=C5)C(CC(C(=O)NC(C(=O)NC4C(=O)NC(C1=O)C7=CC(=C(C(=C7)Cl)O)Cl)C8=CC(=C(C(=C8)Cl)O)Cl)NC(=O)C(=O)C9=CC(=C(C(=C9)Cl)O)Cl)C(=O)N6)C(=O)NC(C1=CC=C(C=C1)O)C(=O)O |
| SMILES (Isomeric) | CN1[C@@H](CC2=CC=C(C=C2)OC3=CC4=CC(=C3O)C5=CC6=C(C=C5)C(C[C@H](C(=O)N[C@@H](C(=O)N[C@H]4C(=O)N[C@@H](C1=O)C7=CC(=C(C(=C7)Cl)O)Cl)C8=CC(=C(C(=C8)Cl)O)Cl)NC(=O)C(=O)C9=CC(=C(C(=C9)Cl)O)Cl)C(=O)N6)C(=O)N[C@H](C1=CC=C(C=C1)O)C(=O)O |
| InChI | InChI=1S/C61H45Cl6N7O16/c1-74-43(56(83)73-48(61(88)89)24-4-7-30(75)8-5-24)12-23-2-9-31(10-3-23)90-44-21-26-13-33(50(44)77)25-6-11-32-34(54(81)68-41(32)20-25)22-42(69-59(86)49(76)29-18-39(66)53(80)40(67)19-29)55(82)70-46(27-14-35(62)51(78)36(63)15-27)57(84)71-45(26)58(85)72-47(60(74)87)28-16-37(64)52(79)38(65)17-28/h2-11,13-21,34,42-43,45-48,75,77-80H,12,22H2,1H3,(H,68,81)(H,69,86)(H,70,82)(H,71,84)(H,72,85)(H,73,83)(H,88,89)/t34?,42-,43+,45-,46-,47-,48-/m1/s1 |
| InChI Key | ZFUGTFLRENMBAG-HYTWXIRXSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C61H45Cl6N7O16 |
| Molecular Weight | 1344.80 g/mol |
| Exact Mass | 1343.102444 g/mol |
| Topological Polar Surface Area (TPSA) | 360.00 Ų |
| XlogP | 8.60 |
| RefChem:927678 |
| (2R)-2-(((17R,20R,23R,26R,29S)-20,26-bis(3,5-dichloro-4-hydroxyphenyl)-17-((2-(3,5-dichloro-4-hydroxyphenyl)-2-oxoacetyl)amino)-37-hydroxy-28-methyl-14,18,21,24,27-pentaoxo-2-oxa-13,19,22,25,28-pentazahexacyclo(29.2.2.13,7.18,12.05,23.011,15)heptatriaconta-1(33),3,5,7(37),8(36),9,11,31,34-nonaene-29-carbonyl)amino)-2-(4-hydroxyphenyl)acetic acid |
| (2R)-2-((((17R,20R,23R,26R,29S)-20,26-bis(3,5-dichloro-4-hydroxyphenyl)-17-((2-(3,5-dichloro-4-hydroxyphenyl)-2-oxoacetyl)amino)-14,18,21,24,37-pentahydroxy-28-methyl-27-oxo-2-oxa-13,19,22,25,28-pentazahexacyclo(29.2.2.13,7.18,12.05,23.011,15)heptatriaconta-1(33),3,5,7(37),8(36),9,11,13,18,21,24,31,34-tridecaen-29-yl)-hydroxymethylidene)amino)-2-(4-hydroxyphenyl)acetic acid |
| Complestatin A |
| complestatins A |
| CHEBI:65655 |
| CHEMBL524665 |
| SCHEMBL14691444 |
| BDBM50478735 |
| Q27134130 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.32% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.89% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.26% | 96.09% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 98.08% | 85.11% |
| CHEMBL236 | P41143 | Delta opioid receptor | 95.87% | 99.35% |
| CHEMBL4422 | O14842 | Free fatty acid receptor 1 | 94.97% | 93.33% |
| CHEMBL238 | Q01959 | Dopamine transporter | 94.34% | 95.88% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.94% | 97.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.01% | 90.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.58% | 99.15% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.52% | 91.19% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 92.44% | 90.71% |
| CHEMBL204 | P00734 | Thrombin | 92.13% | 96.01% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 91.41% | 92.29% |
| CHEMBL2083 | P15090 | Fatty acid binding protein adipocyte | 91.41% | 95.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.98% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.54% | 86.33% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 89.90% | 85.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 89.87% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.79% | 95.89% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 88.73% | 98.35% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.08% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.89% | 94.45% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 87.40% | 89.44% |
| CHEMBL2820 | P03951 | Coagulation factor XI | 86.27% | 95.29% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 86.17% | 89.50% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 85.96% | 95.71% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 85.88% | 96.39% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 85.09% | 95.38% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.08% | 93.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.78% | 85.14% |
| CHEMBL2850 | P49840 | Glycogen synthase kinase-3 alpha | 83.09% | 88.84% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 82.89% | 88.42% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.11% | 94.00% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 81.72% | 89.67% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.32% | 95.78% |
| CHEMBL4235 | P28845 | 11-beta-hydroxysteroid dehydrogenase 1 | 81.05% | 97.98% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 80.93% | 97.50% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 80.15% | 80.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 16134417 |
| LOTUS | LTS0078026 |
| wikiData | Q27134130 |