Neuchromenin
| Internal ID | 89b84e39-3136-42ae-a88e-415d26c74ab1 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans |
| IUPAC Name | (2S)-8,9-dihydroxy-2-methyl-3,5-dihydro-2H-pyrano[3,2-c]chromen-4-one |
| SMILES (Canonical) | CC1CC(=O)C2=C(O1)C3=CC(=C(C=C3OC2)O)O |
| SMILES (Isomeric) | C[C@H]1CC(=O)C2=C(O1)C3=CC(=C(C=C3OC2)O)O |
| InChI | InChI=1S/C13H12O5/c1-6-2-9(14)8-5-17-12-4-11(16)10(15)3-7(12)13(8)18-6/h3-4,6,15-16H,2,5H2,1H3/t6-/m0/s1 |
| InChI Key | SGTSJAOFFFAYJH-LURJTMIESA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C13H12O5 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.06847348 g/mol |
| Topological Polar Surface Area (TPSA) | 76.00 Ų |
| XlogP | 0.90 |
| 180964-26-5 |
| (2S)-8,9-dihydroxy-2-methyl-3,5-dihydro-2H-pyrano[3,2-c]chromen-4-one |
| HY-N9085 |
| AKOS040762115 |
| CS-0158671 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.05% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.33% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.10% | 95.56% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.65% | 93.40% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.15% | 89.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.25% | 85.14% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.80% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.95% | 99.23% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 86.72% | 94.80% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.44% | 96.21% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 84.02% | 86.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.00% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10729197 |
| LOTUS | LTS0071110 |
| wikiData | Q77520066 |