Netropsin
| Internal ID | 84dd354a-2d21-4f38-b7a8-03c2dac7bc0a |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Alpha amino acid amides |
| IUPAC Name | N-[5-[(3-amino-3-iminopropyl)carbamoyl]-1-methylpyrrol-3-yl]-4-[[2-(diaminomethylideneamino)acetyl]amino]-1-methylpyrrole-2-carboxamide |
| SMILES (Canonical) | CN1C=C(C=C1C(=O)NC2=CN(C(=C2)C(=O)NCCC(=N)N)C)NC(=O)CN=C(N)N |
| SMILES (Isomeric) | CN1C=C(C=C1C(=O)NC2=CN(C(=C2)C(=O)NCCC(=N)N)C)NC(=O)CN=C(N)N |
| InChI | InChI=1S/C18H26N10O3/c1-27-9-11(6-12(27)16(30)23-4-3-14(19)20)26-17(31)13-5-10(8-28(13)2)25-15(29)7-24-18(21)22/h5-6,8-9H,3-4,7H2,1-2H3,(H3,19,20)(H,23,30)(H,25,29)(H,26,31)(H4,21,22,24) |
| InChI Key | IDBIFFKSXLYUOT-UHFFFAOYSA-N |
| Popularity | 598 references in papers |
| Molecular Formula | C18H26N10O3 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.21893473 g/mol |
| Topological Polar Surface Area (TPSA) | 211.00 Ų |
| XlogP | -3.10 |
| 1438-30-8 |
| Antibiotic 1142 |
| Sinanomycin |
| Congocidin |
| Congocidine |
| Antibiotic T-1384 |
| Netropsin dihydrochloride |
| 64B3O0RD7N |
| CHEMBL307767 |
| N-(3-amino-3-iminopropyl)-4-(4-(2-guanidinoacetamido)-1-methyl-1H-pyrrole-2-carboxamido)-1-methyl-1H-pyrrole-2-carboxamide |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.45% | 96.09% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 95.12% | 89.63% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 90.68% | 91.79% |
| CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 90.41% | 97.88% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.74% | 94.73% |
| CHEMBL1974 | P36888 | Tyrosine-protein kinase receptor FLT3 | 88.46% | 91.83% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.03% | 90.00% |
| CHEMBL5122 | Q16832 | Discoidin domain-containing receptor 2 | 87.92% | 92.73% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.66% | 90.71% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.04% | 99.17% |
| CHEMBL5319 | Q08345 | Epithelial discoidin domain-containing receptor 1 | 86.83% | 90.30% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 86.57% | 87.16% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.19% | 95.56% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 86.11% | 95.17% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.97% | 91.07% |
| CHEMBL1936 | P10721 | Stem cell growth factor receptor | 81.90% | 84.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 4461 |
| LOTUS | LTS0135090 |
| wikiData | Q3874969 |