Nervonin G
| Internal ID | 947b9c76-fd4c-400e-8677-ffc6fa80c880 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
| IUPAC Name | [(1S,2R,3R,4R,6S,8S,9S,10S,11S,13S,15R)-2,3-diacetyloxy-6,11,15-trihydroxy-5,5,9-trimethyl-14-methylidene-8-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
| SMILES (Canonical) | CC(=O)OC1CC(C(C2C1(C3C(CC4CC3(C(C2OC(=O)C)OC(=O)C)C(C4=C)O)O)C)(C)C)O |
| SMILES (Isomeric) | CC(=O)O[C@H]1C[C@@H](C([C@@H]2[C@@]1([C@@H]3[C@H](C[C@@H]4C[C@@]3([C@H]([C@@H]2OC(=O)C)OC(=O)C)[C@@H](C4=C)O)O)C)(C)C)O |
| InChI | InChI=1S/C26H38O9/c1-11-15-8-16(30)20-25(7)18(33-12(2)27)9-17(31)24(5,6)21(25)19(34-13(3)28)23(35-14(4)29)26(20,10-15)22(11)32/h15-23,30-32H,1,8-10H2,2-7H3/t15-,16+,17+,18+,19-,20+,21-,22-,23+,25+,26+/m1/s1 |
| InChI Key | DRJJWTMAGJAYQX-LBFLOJCHSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C26H38O9 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.25158279 g/mol |
| Topological Polar Surface Area (TPSA) | 140.00 Ų |
| XlogP | 1.20 |
| CHEMBL468977 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.63% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.38% | 91.11% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.73% | 95.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.15% | 91.19% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.57% | 94.45% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.54% | 82.69% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.45% | 97.21% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.23% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.98% | 95.56% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.32% | 91.07% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.55% | 97.09% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.24% | 91.24% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 80.19% | 83.82% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Isodon nervosus |
| Isodon wikstroemioides |
| PubChem | 24862641 |
| LOTUS | LTS0026062 |
| wikiData | Q104987443 |