Neobudofficide
Internal ID | 1d89402e-83b6-415c-921c-568067c0e15a |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 7-[(2S,4S,5S)-4,5-dihydroxy-3-[(2R,3S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-6-[[(2R,3S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-5-hydroxy-2-(4-methoxyphenyl)chromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)OC)O)OC6C(C(C(C(O6)C)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | CC1[C@@H](C([C@@H]([C@@H](O1)OCC2[C@H]([C@@H](C([C@@H](O2)OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)OC)O)O[C@H]6[C@H](C([C@H](C(O6)C)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C34H42O18/c1-12-23(37)26(40)29(43)32(47-12)46-11-21-25(39)28(42)31(52-33-30(44)27(41)24(38)13(2)48-33)34(51-21)49-16-8-17(35)22-18(36)10-19(50-20(22)9-16)14-4-6-15(45-3)7-5-14/h4-10,12-13,21,23-35,37-44H,11H2,1-3H3/t12?,13?,21?,23-,24-,25+,26?,27?,28-,29-,30-,31?,32+,33-,34+/m0/s1 |
InChI Key | XQQFUXJSLVWQSS-UOMQSTFGSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C34H42O18 |
Molecular Weight | 738.70 g/mol |
Exact Mass | 738.23711449 g/mol |
Topological Polar Surface Area (TPSA) | 273.00 Ų |
XlogP | -1.60 |
Acacetin 7-(2G-rhamnosyl)-rutinoside |
LMPK12110463 |
![2D Structure of Neobudofficide 2D Structure of Neobudofficide](https://plantaedb.com/storage/docs/compounds/2023/07/neobudofficide.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.71% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.08% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.81% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.27% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 95.86% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.21% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.38% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.21% | 99.15% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 93.48% | 97.36% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.03% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.33% | 95.56% |
CHEMBL1907 | P15144 | Aminopeptidase N | 89.73% | 93.31% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 89.37% | 81.11% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.14% | 86.92% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.58% | 96.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.37% | 90.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.32% | 97.09% |
CHEMBL3194 | P02766 | Transthyretin | 84.45% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.37% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.43% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.42% | 99.17% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 82.98% | 83.57% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Buddleja officinalis |
Staphylea arguta |