Ncnuksmlrptjbc-nxtblzeosa-
Internal ID | 92d6021a-8446-4ab6-9e6c-8b3c424fdca0 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
IUPAC Name | (3aR,4S,9aS,9bR)-4-hydroxy-6-methyl-3-methylidene-9-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-2,7-dione |
SMILES (Canonical) | CC1=C2C(C3C(C(C1)O)C(=C)C(=O)O3)C(=CC2=O)COC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | CC1=C2[C@@H]([C@@H]3[C@@H]([C@H](C1)O)C(=C)C(=O)O3)C(=CC2=O)CO[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
InChI | InChI=1S/C21H26O10/c1-7-3-10(23)14-8(2)20(28)31-19(14)15-9(4-11(24)13(7)15)6-29-21-18(27)17(26)16(25)12(5-22)30-21/h4,10,12,14-19,21-23,25-27H,2-3,5-6H2,1H3/t10-,12+,14+,15-,16+,17-,18+,19-,21+/m0/s1 |
InChI Key | NCNUKSMLRPTJBC-NXTBLZEOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H26O10 |
Molecular Weight | 438.40 g/mol |
Exact Mass | 438.15259702 g/mol |
Topological Polar Surface Area (TPSA) | 163.00 Ų |
XlogP | -2.30 |
NCNUKSMLRPTJBC-NXTBLZEOSA- |
InChI=1/C21H26O10/c1-7-3-10(23)14-8(2)20(28)31-19(14)15-9(4-11(24)13(7)15)6-29-21-18(27)17(26)16(25)12(5-22)30-21/h4,10,12,14-19,21-23,25-27H,2-3,5-6H2,1H3/t10-,12+,14+,15-,16+,17-,18+,19-,21+/m0/s1 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.55% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.62% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 91.73% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.86% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.25% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.07% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.95% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.02% | 97.09% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 86.11% | 97.36% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.72% | 94.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.67% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.58% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.68% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.85% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lactuca virosa |
Picris hieracioides |
PubChem | 21636022 |
LOTUS | LTS0197101 |
wikiData | Q105177292 |