Ncgc00380777-01_C77H120N16O19_
| Internal ID | a572b7e7-398f-419c-8b82-0abde0137223 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 2-[[1-[2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[(2-acetamido-3-phenylpropanoyl)amino]-2-methylpropanoyl]amino]-2-methylpropanoyl]amino]-2-methylpropanoyl]amino]-3-methylbutanoyl]amino]acetyl]amino]-4-methylpentanoyl]amino]-2-methylpropanoyl]amino]-2-methylpropanoyl]-4-hydroxypyrrolidine-2-carbonyl]amino]-N-[1-[4-hydroxy-2-[[1-[(1-hydroxy-3-phenylpropan-2-yl)amino]-2-methyl-1-oxopropan-2-yl]carbamoyl]pyrrolidin-1-yl]-2-methyl-1-oxobutan-2-yl]pentanediamide |
| SMILES (Canonical) | CCC(C)(C(=O)N1CC(CC1C(=O)NC(C)(C)C(=O)NC(CC2=CC=CC=C2)CO)O)NC(=O)C(CCC(=O)N)NC(=O)C3CC(CN3C(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)C(CC(C)C)NC(=O)CNC(=O)C(C(C)C)NC(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)C(CC4=CC=CC=C4)NC(=O)C)O |
| SMILES (Isomeric) | CCC(C)(C(=O)N1CC(CC1C(=O)NC(C)(C)C(=O)NC(CC2=CC=CC=C2)CO)O)NC(=O)C(CCC(=O)N)NC(=O)C3CC(CN3C(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)C(CC(C)C)NC(=O)CNC(=O)C(C(C)C)NC(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)C(CC4=CC=CC=C4)NC(=O)C)O |
| InChI | InChI=1S/C77H120N16O19/c1-20-77(19,70(112)93-40-49(97)37-54(93)62(104)87-71(7,8)64(106)81-47(41-94)34-45-27-23-21-24-28-45)88-58(100)50(31-32-55(78)98)83-61(103)53-36-48(96)39-92(53)69(111)76(17,18)91-67(109)74(13,14)85-59(101)51(33-42(2)3)82-56(99)38-79-63(105)57(43(4)5)84-65(107)72(9,10)89-68(110)75(15,16)90-66(108)73(11,12)86-60(102)52(80-44(6)95)35-46-29-25-22-26-30-46/h21-30,42-43,47-54,57,94,96-97H,20,31-41H2,1-19H3,(H2,78,98)(H,79,105)(H,80,95)(H,81,106)(H,82,99)(H,83,103)(H,84,107)(H,85,101)(H,86,102)(H,87,104)(H,88,100)(H,89,110)(H,90,108)(H,91,109) |
| InChI Key | LSJHBSMFQYTUER-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C77H120N16O19 |
| Molecular Weight | 1573.90 g/mol |
| Exact Mass | 1572.89156566 g/mol |
| Topological Polar Surface Area (TPSA) | 523.00 Ų |
| XlogP | 0.20 |
| Atomic LogP (AlogP) | -2.43 |
| H-Bond Acceptor | 19 |
| H-Bond Donor | 17 |
| Rotatable Bonds | 39 |
| NCGC00380777-01_C77H120N16O19_ |
| 52931-42-7 |
| AKOS040734786 |
| NCGC00380777-01 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8802 | 88.02% |
| Caco-2 | - | 0.8619 | 86.19% |
| Blood Brain Barrier | - | 0.8500 | 85.00% |
| Human oral bioavailability | - | 0.6714 | 67.14% |
| Subcellular localzation | Lysosomes | 0.5510 | 55.10% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8442 | 84.42% |
| OATP1B3 inhibitior | + | 0.9310 | 93.10% |
| MATE1 inhibitior | - | 0.9012 | 90.12% |
| OCT2 inhibitior | - | 0.8250 | 82.50% |
| BSEP inhibitior | + | 0.9767 | 97.67% |
| P-glycoprotein inhibitior | + | 0.7421 | 74.21% |
| P-glycoprotein substrate | + | 0.8774 | 87.74% |
| CYP3A4 substrate | + | 0.7456 | 74.56% |
| CYP2C9 substrate | - | 0.7958 | 79.58% |
| CYP2D6 substrate | - | 0.8176 | 81.76% |
| CYP3A4 inhibition | + | 0.8429 | 84.29% |
| CYP2C9 inhibition | - | 0.8072 | 80.72% |
| CYP2C19 inhibition | - | 0.7374 | 73.74% |
| CYP2D6 inhibition | - | 0.7827 | 78.27% |
| CYP1A2 inhibition | - | 0.9575 | 95.75% |
| CYP2C8 inhibition | + | 0.6835 | 68.35% |
| CYP inhibitory promiscuity | - | 0.9258 | 92.58% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.7100 | 71.00% |
| Carcinogenicity (trinary) | Non-required | 0.6147 | 61.47% |
| Eye corrosion | - | 0.9906 | 99.06% |
| Eye irritation | - | 0.8955 | 89.55% |
| Skin irritation | - | 0.7960 | 79.60% |
| Skin corrosion | - | 0.9172 | 91.72% |
| Ames mutagenesis | - | 0.6100 | 61.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7206 | 72.06% |
| Micronuclear | + | 0.7800 | 78.00% |
| Hepatotoxicity | + | 0.5282 | 52.82% |
| skin sensitisation | - | 0.8903 | 89.03% |
| Respiratory toxicity | + | 0.8667 | 86.67% |
| Reproductive toxicity | + | 0.9444 | 94.44% |
| Mitochondrial toxicity | + | 0.9000 | 90.00% |
| Nephrotoxicity | - | 0.8556 | 85.56% |
| Acute Oral Toxicity (c) | III | 0.6509 | 65.09% |
| Estrogen receptor binding | - | 0.5439 | 54.39% |
| Androgen receptor binding | + | 0.7665 | 76.65% |
| Thyroid receptor binding | + | 0.7682 | 76.82% |
| Glucocorticoid receptor binding | + | 0.8417 | 84.17% |
| Aromatase binding | + | 0.8034 | 80.34% |
| PPAR gamma | + | 0.7812 | 78.12% |
| Honey bee toxicity | - | 0.7247 | 72.47% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | - | 0.6000 | 60.00% |
| Fish aquatic toxicity | + | 0.8535 | 85.35% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.95% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.79% | 96.61% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 99.16% | 90.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.78% | 96.09% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 97.19% | 97.14% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 96.95% | 98.33% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 96.84% | 94.45% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 95.49% | 82.69% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.85% | 91.11% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 94.15% | 97.23% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 93.44% | 91.19% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.35% | 97.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.15% | 93.56% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 92.02% | 100.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 91.19% | 93.00% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 91.14% | 89.33% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 90.51% | 95.50% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 90.40% | 98.94% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 89.89% | 95.38% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 89.63% | 97.64% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 89.10% | 97.50% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 88.88% | 96.03% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 88.82% | 100.00% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 88.68% | 96.67% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.13% | 100.00% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 87.71% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.41% | 99.17% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.91% | 97.21% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.43% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.26% | 96.00% |
| CHEMBL3891 | P07384 | Calpain 1 | 86.17% | 93.04% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.14% | 97.25% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 85.72% | 88.42% |
| CHEMBL5028 | O14672 | ADAM10 | 85.35% | 97.50% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.03% | 90.71% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.49% | 95.89% |
| CHEMBL236 | P41143 | Delta opioid receptor | 84.30% | 99.35% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.10% | 98.75% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.02% | 94.08% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.76% | 96.47% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 83.63% | 92.80% |
| CHEMBL4801 | P29466 | Caspase-1 | 82.60% | 96.85% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.45% | 96.90% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 81.83% | 97.29% |
| CHEMBL2664 | P23526 | Adenosylhomocysteinase | 81.74% | 86.67% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 81.26% | 85.11% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 81.20% | 96.37% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 80.81% | 94.23% |
| CHEMBL1841 | P06241 | Tyrosine-protein kinase FYN | 80.54% | 81.29% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.36% | 89.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10057371 |
| LOTUS | LTS0038788 |
| wikiData | Q104171277 |