Napyradiomycin 2
| Internal ID | 4951bb2e-2025-4316-ba3e-e440e48205a1 |
| Taxonomy | Organoheterocyclic compounds > Naphthopyrans > Naphthopyranones |
| IUPAC Name | (1R,3Z,7E,18S)-11,18,22-trihydroxy-8-(hydroxymethyl)-4,19,19-trimethyl-20-oxatetracyclo[11.7.1.110,14.01,16]docosa-3,7,10,12,14(22),16-hexaene-15,21-dione |
| SMILES (Canonical) | CC1=CCC23C(=CC(C(O2)(C)C)O)C(=O)C4=C(C(=C(C=C4C3=O)O)CC(=CCC1)CO)O |
| SMILES (Isomeric) | C/C/1=C/C[C@]23C(=C[C@@H](C(O2)(C)C)O)C(=O)C4=C(C(=C(C=C4C3=O)O)C/C(=C\CC1)/CO)O |
| InChI | InChI=1S/C25H28O7/c1-13-5-4-6-14(12-26)9-15-18(27)10-16-20(21(15)29)22(30)17-11-19(28)24(2,3)32-25(17,8-7-13)23(16)31/h6-7,10-11,19,26-29H,4-5,8-9,12H2,1-3H3/b13-7-,14-6+/t19-,25+/m0/s1 |
| InChI Key | BKEDHHFOCFGVBQ-QVWGALEVSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H28O7 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18350323 g/mol |
| Topological Polar Surface Area (TPSA) | 124.00 Ų |
| XlogP | 1.40 |
| (1R,3Z,7E,18S)-11,18,22-trihydroxy-8-(hydroxymethyl)-4,19,19-trimethyl-20-oxatetracyclo[11.7.1.110,14.01,16]docosa-3,7,10,12,14(22),16-hexaene-15,21-dione |
| (1R,3Z,7E,18S)-11,18,22-trihydroxy-8-(hydroxymethyl)-4,19,19-trimethyl-20-oxatetracyclo(11.7.1.110,14.01,16)docosa-3,7,10,12,14(22),16-hexaene-15,21-dione |
| RefChem:164793 |
| CHEBI:202245 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.62% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.05% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.34% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.16% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.08% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.05% | 97.09% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 91.09% | 85.11% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.80% | 95.89% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.52% | 90.00% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 86.78% | 96.38% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.75% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.36% | 99.23% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.25% | 90.71% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 85.72% | 96.77% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 84.21% | 97.50% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.75% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.02% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.64% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 102101060 |
| LOTUS | LTS0092154 |
| wikiData | Q77370140 |